The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(1,3-Dioxoisoindolin-2-yl)propoxy)-N-hydroxy-2-phenylacetamide ID: ALA4748151
PubChem CID: 162649754
Max Phase: Preclinical
Molecular Formula: C19H18N2O5
Molecular Weight: 354.36
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NO)C(OCCCN1C(=O)c2ccccc2C1=O)c1ccccc1
Standard InChI: InChI=1S/C19H18N2O5/c22-17(20-25)16(13-7-2-1-3-8-13)26-12-6-11-21-18(23)14-9-4-5-10-15(14)19(21)24/h1-5,7-10,16,25H,6,11-12H2,(H,20,22)
Standard InChI Key: ZZLGCXFNIQEECP-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
31.1724 -8.9805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8788 -8.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5878 -8.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2943 -8.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0032 -8.9720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7097 -8.5613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4186 -8.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7072 -7.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4190 -7.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4169 -6.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7075 -6.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9987 -6.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0042 -7.3415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4210 -9.7850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1251 -8.5571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8340 -8.9635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4286 -8.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0931 -9.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2943 -9.9669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8847 -9.2606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0701 -9.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6640 -9.9713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0786 -10.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8919 -10.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7007 -10.3411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2558 -7.8490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
7 15 1 0
15 16 1 0
1 17 1 0
17 20 1 0
19 18 1 0
18 1 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
18 25 2 0
17 26 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 354.36Molecular Weight (Monoisotopic): 354.1216AlogP: 1.94#Rotatable Bonds: 7Polar Surface Area: 95.94Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.58CX Basic pKa: ┄CX LogP: 1.53CX LogD: 1.51Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.34Np Likeness Score: -0.72
References 1. Mak JYW,Wu KC,Gupta PK,Barbero S,McLaughlin MG,Lucke AJ,Tng J,Lim J,Loh Z,Sweet MJ,Reid RC,Liu L,Fairlie DP. (2021) HDAC7 Inhibition by Phenacetyl and Phenylbenzoyl Hydroxamates., 64 (4.0): [PMID:33570940 ] [10.1021/acs.jmedchem.0c01967 ]