The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(((2,3-Dihydrobenzofuran-5-yl)methyl)carbamoyl)-7-nitro-5-(trifluoromethyl)benzo[d]thiazole 3-oxide ID: ALA4748196
PubChem CID: 162650160
Max Phase: Preclinical
Molecular Formula: C18H12F3N3O5S
Molecular Weight: 439.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCc1ccc2c(c1)CCO2)c1sc2c([N+](=O)[O-])cc(C(F)(F)F)cc2[n+]1[O-]
Standard InChI: InChI=1S/C18H12F3N3O5S/c19-18(20,21)11-6-12-15(13(7-11)24(27)28)30-17(23(12)26)16(25)22-8-9-1-2-14-10(5-9)3-4-29-14/h1-2,5-7H,3-4,8H2,(H,22,25)
Standard InChI Key: QWDMDRDYEDGWQO-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
8.1637 -8.3081 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.5764 -9.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9848 -8.3056 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.5086 -10.4388 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.9760 -9.7689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4836 -9.1168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7104 -9.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7278 -10.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0276 -10.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3142 -10.2324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2968 -9.4155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9928 -8.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0450 -11.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7626 -11.8383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3449 -11.8663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7930 -9.7515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1875 -9.0340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2154 -10.4517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0044 -9.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4222 -6.0873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.7523 -5.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1002 -6.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3710 -6.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1879 -6.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9765 -7.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3989 -8.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2158 -8.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6103 -7.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7179 -8.3361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8802 -9.4443 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
4 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
8 9 2 0
11 2 1 0
13 14 2 0
13 15 1 0
9 13 1 0
16 17 1 0
16 18 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
20 24 1 0
25 26 1 0
26 27 2 0
27 28 1 0
24 28 2 0
23 25 2 0
19 26 1 0
17 19 1 0
5 16 1 0
6 29 1 0
2 30 1 0
M CHG 4 6 1 13 1 15 -1 29 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.37Molecular Weight (Monoisotopic): 439.0450AlogP: 3.33#Rotatable Bonds: 4Polar Surface Area: 108.41Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.11CX Basic pKa: ┄CX LogP: 3.32CX LogD: 3.32Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.29Np Likeness Score: -1.03
References 1. Liu, Rui, Markley, Lowell, Miller, Patricia A., Franzblau, Scott, Shetye, Gauri, Ma, Rui, Savkova, Karin, Mikusova, Katarina, Lee, Bei Shi, Pethe, Kevin, Moraski, Garrett C., Miller, Marvin J.. (2021) Hydride-induced Meisenheimer complex formation reflects activity of nitro aromatic anti-tuberculosis compounds, 12 (1): [PMID:34046598 ] [10.1039/d0md00390e ]