(+)-8-methyl-8a-phenyl-1,2,3,3a,8,8a-hexahydropyrrolo[2,3-b]indol-3a-ol

ID: ALA4749051

PubChem CID: 162649859

Max Phase: Preclinical

Molecular Formula: C17H18N2O

Molecular Weight: 266.34

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1c2ccccc2[C@@]2(O)CCN[C@@]12c1ccccc1

Standard InChI:  InChI=1S/C17H18N2O/c1-19-15-10-6-5-9-14(15)16(20)11-12-18-17(16,19)13-7-3-2-4-8-13/h2-10,18,20H,11-12H2,1H3/t16-,17-/m0/s1

Standard InChI Key:  XAIQYSJTZAPIFN-IRXDYDNUSA-N

Molfile:  

 
     RDKit          2D

 20 23  0  0  0  0  0  0  0  0999 V2000
   31.2637  -13.0554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7516  -12.3925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2704  -11.7249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4837  -12.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4919  -11.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7041  -13.0422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.2330  -12.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7183  -11.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4001  -10.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5927  -10.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1045  -11.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4295  -12.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4837  -11.1600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4755  -13.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7576  -14.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7490  -14.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4570  -15.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1750  -14.8501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1800  -14.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4437  -13.8209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  1  0
  2  3  1  0
  3  5  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  6  4  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5 13  1  6
  4 14  1  6
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
  6 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4749051

    ---

Associated Targets(Human)

GABRA1 Tclin GABA-A receptor; alpha-1/beta-2/gamma-2 (1171 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 266.34Molecular Weight (Monoisotopic): 266.1419AlogP: 2.17#Rotatable Bonds: 1
Polar Surface Area: 35.50Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.82CX Basic pKa: 7.30CX LogP: 2.93CX LogD: 2.68
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.83Np Likeness Score: 0.80

References

1. Blom AEM,Su JY,Repka LM,Reisman SE,Dougherty DA.  (2020)  Synthesis and Biological Evaluation of Pyrroloindolines as Positive Allosteric Modulators of the α1β2γ2 GABA Receptor.,  11  (11): [PMID:33214830] [10.1021/acsmedchemlett.0c00340]

Source