The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)sulfonyl)-1-(4-ethylpiperazin-1-yl)ethan-1-one ID: ALA4749215
PubChem CID: 162651957
Max Phase: Preclinical
Molecular Formula: C28H35ClN6O6S2
Molecular Weight: 651.21
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(C(=O)CS(=O)(=O)c2ccc(Nc3ncc(Cl)c(Nc4ccccc4S(=O)(=O)C(C)C)n3)c(OC)c2)CC1
Standard InChI: InChI=1S/C28H35ClN6O6S2/c1-5-34-12-14-35(15-13-34)26(36)18-42(37,38)20-10-11-22(24(16-20)41-4)32-28-30-17-21(29)27(33-28)31-23-8-6-7-9-25(23)43(39,40)19(2)3/h6-11,16-17,19H,5,12-15,18H2,1-4H3,(H2,30,31,32,33)
Standard InChI Key: MAKLQLGGXQPLRV-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
24.7634 -9.0964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1761 -9.8063 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.5845 -9.0939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.9316 -12.2661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1144 -12.2661 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.5230 -12.9738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2303 -10.2231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2291 -11.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9372 -11.4516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6468 -11.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6440 -10.2195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9354 -9.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3552 -11.4497 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0622 -11.0399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5211 -11.4507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8137 -11.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8189 -10.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1123 -9.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4033 -10.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4053 -11.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1124 -11.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7673 -11.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4738 -11.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4730 -10.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7597 -9.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0560 -10.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4091 -12.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8884 -10.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5949 -9.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3038 -10.2126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.7673 -12.2651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4751 -12.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6991 -12.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4137 -13.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5224 -9.8147 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.5926 -8.9888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3062 -11.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0103 -9.8019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7192 -10.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7216 -11.0257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4305 -11.4322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0151 -11.4363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1370 -11.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 2 0
6 5 2 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 1 0
8 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 14 1 0
24 2 1 0
21 5 1 0
5 27 1 0
2 28 1 0
28 29 1 0
29 30 1 0
22 31 1 0
31 32 1 0
27 33 1 0
27 34 1 0
7 35 1 0
29 36 2 0
30 37 1 0
30 38 1 0
38 39 1 0
37 42 1 0
39 40 1 0
40 41 1 0
40 42 1 0
41 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 651.21Molecular Weight (Monoisotopic): 650.1748AlogP: 3.75#Rotatable Bonds: 11Polar Surface Area: 150.90Molecular Species: NEUTRALHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.20CX Basic pKa: 5.28CX LogP: 3.19CX LogD: 3.18Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.31Np Likeness Score: -1.83
References 1. Zhu M,Li W,Zhao T,Chen Y,Li T,Wei S,Guo M,Zhai X. (2020) Fragment-based modification of 2,4-diarylaminopyrimidine derivatives as ALK and ROS1 dual inhibitors to overcome secondary mutants., 28 (20.0): [PMID:33069075 ] [10.1016/j.bmc.2020.115719 ]