2-chloro-3-(2-(piperazin-1-yl)ethylamino)naphthalene-1,4-dione

ID: ALA4749230

Cas Number: 6956-30-5

PubChem CID: 248304

Max Phase: Preclinical

Molecular Formula: C16H18ClN3O2

Molecular Weight: 319.79

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1C(Cl)=C(NCCN2CCNCC2)C(=O)c2ccccc21

Standard InChI:  InChI=1S/C16H18ClN3O2/c17-13-14(19-7-10-20-8-5-18-6-9-20)16(22)12-4-2-1-3-11(12)15(13)21/h1-4,18-19H,5-10H2

Standard InChI Key:  NSSMXCNEKHURJO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   10.5761   -7.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5761   -8.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2899   -8.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2899   -7.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8630   -8.9711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1463   -8.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4328   -8.9675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0037   -7.7316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0020   -8.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7147   -8.9690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4295   -8.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4272   -7.7288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7139   -7.3203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2911   -9.7951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2899   -6.4869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8586   -7.3202    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.7169   -8.5533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7220   -7.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0103   -7.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2912   -7.7238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2884   -8.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0047   -8.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  4  1  0
  2  3  1  0
  3  9  1  0
  8  4  1  0
  5  6  1  0
  6  7  1  0
  2  5  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  3 14  2  0
  4 15  2  0
  1 16  1  0
  7 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
M  END

Associated Targets(Human)

CTH Tchem Cystathionine gamma-lyase (128 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 319.79Molecular Weight (Monoisotopic): 319.1088AlogP: 1.01#Rotatable Bonds: 4
Polar Surface Area: 61.44Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.01CX LogP: 0.64CX LogD: -0.97
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.87Np Likeness Score: -0.73

References

1. Hu Y,Wang L,Han X,Zhou Y,Zhang T,Wang L,Hong T,Zhang W,Guo XX,Sun J,Qi Y,Yu J,Liu H,Wu F.  (2019)  Discovery of a Bioactive Inhibitor with a New Scaffold for Cystathionine γ-Lyase.,  62  (3): [PMID:30562026] [10.1021/acs.jmedchem.8b01720]

Source