The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-(4-(3-(2-chloro-6-fluorophenyl)ureido)-1H-pyrazol-1-yl)-5-methyl-N-(tetrahydrofuran-3-yl)thiophene-2-carboxamide ID: ALA4749547
PubChem CID: 162651427
Max Phase: Preclinical
Molecular Formula: C20H19ClFN5O3S
Molecular Weight: 463.92
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1sc(C(=O)N[C@@H]2CCOC2)cc1-n1cc(NC(=O)Nc2c(F)cccc2Cl)cn1
Standard InChI: InChI=1S/C20H19ClFN5O3S/c1-11-16(7-17(31-11)19(28)24-12-5-6-30-10-12)27-9-13(8-23-27)25-20(29)26-18-14(21)3-2-4-15(18)22/h2-4,7-9,12H,5-6,10H2,1H3,(H,24,28)(H2,25,26,29)/t12-/m1/s1
Standard InChI Key: VPVAOTNNZQMZSM-GFCCVEGCSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
32.4345 -22.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4333 -23.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1414 -24.0644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8510 -23.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8482 -22.8323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1396 -22.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5594 -24.0625 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.1412 -24.8816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4334 -25.2900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7258 -24.8813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4332 -26.1072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.0179 -25.2897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2724 -24.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7254 -25.5673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.1339 -26.2751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9332 -26.1053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8001 -27.0226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0008 -27.1924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9152 -28.0051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6618 -28.3376 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.2086 -27.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2075 -28.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2073 -29.2308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4998 -28.0049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.5000 -27.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7253 -24.0635 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.0213 -27.8159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1598 -26.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9074 -25.9289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0902 -25.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8377 -26.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
3 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 17 2 0
15 17 1 0
19 22 1 0
22 23 2 0
22 24 1 0
25 24 1 6
2 26 1 0
21 27 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.92Molecular Weight (Monoisotopic): 463.0881AlogP: 4.20#Rotatable Bonds: 5Polar Surface Area: 97.28Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.85CX Basic pKa: 0.75CX LogP: 3.49CX LogD: 3.48Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -2.12
References 1. Feng Y,Park H,Bauer L,Ryu JC,Yoon SO. (2021) Thiophene-Pyrazolourea Derivatives as Potent, Orally Bioavailable, and Isoform-Selective JNK3 Inhibitors., 12 (1.0): [PMID:33488960 ] [10.1021/acsmedchemlett.0c00533 ]