The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(O-(Hydroxy(((S)-1-methoxy-3-(oleoyloxy)-propan-2-yl)oxy)-phosphoryl)-L-serine ID: ALA4750036
PubChem CID: 78319629
Max Phase: Preclinical
Molecular Formula: C25H48NO9P
Molecular Weight: 537.63
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COC)OP(=O)(O)OC[C@H](N)C(=O)O
Standard InChI: InChI=1S/C25H48NO9P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24(27)33-20-22(19-32-2)35-36(30,31)34-21-23(26)25(28)29/h10-11,22-23H,3-9,12-21,26H2,1-2H3,(H,28,29)(H,30,31)/b11-10-/t22-,23-/m0/s1
Standard InChI Key: AWVXRDOQCOHYDO-NXDWNWMYSA-N
Molfile:
RDKit 2D
36 35 0 0 0 0 0 0 0 0999 V2000
17.3391 -15.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3381 -16.4159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0336 -15.1812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7503 -15.5713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4469 -15.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1635 -15.5398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8601 -15.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5767 -15.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2733 -15.0867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9899 -15.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6279 -15.1965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0105 -16.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3132 -16.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5955 -16.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8983 -16.7555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1805 -16.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4833 -16.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7655 -16.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0683 -16.8266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0889 -17.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0904 -13.2567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5031 -13.9665 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
14.9115 -13.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3817 -14.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0894 -13.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6740 -13.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9663 -14.3793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6740 -13.1535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3817 -15.1965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7971 -14.3793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2125 -14.3793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9202 -13.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6279 -14.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9202 -13.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6279 -12.7449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6279 -11.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
1 11 1 0
10 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
22 21 2 0
23 22 1 0
24 25 1 0
24 26 1 0
26 27 1 0
26 28 2 0
24 29 1 6
25 30 1 0
30 22 1 0
22 31 1 0
31 32 1 0
32 33 1 0
33 11 1 0
32 34 1 1
34 35 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.63Molecular Weight (Monoisotopic): 537.3067AlogP: 5.13#Rotatable Bonds: 25Polar Surface Area: 154.61Molecular Species: ZWITTERIONHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.43CX Basic pKa: 9.38CX LogP: 3.74CX LogD: 0.76Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.06Np Likeness Score: 0.93
References 1. Nakamura S,Sayama M,Uwamizu A,Jung S,Ikubo M,Otani Y,Kano K,Omi J,Inoue A,Aoki J,Ohwada T. (2020) Non-naturally Occurring Regio Isomer of Lysophosphatidylserine Exhibits Potent Agonistic Activity toward G Protein-Coupled Receptors., 63 (17): [PMID:32787112 ] [10.1021/acs.jmedchem.0c01126 ]