The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl (E)-3-((5S)-5-acetamido-3-hydroxy-9,10,11-trimethoxy-6,7-dihydro-5H-dibenzo-[a,c]cycloheptene-2-yl)acrylate ID: ALA4750077
PubChem CID: 162651450
Max Phase: Preclinical
Molecular Formula: C24H27NO7
Molecular Weight: 441.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)/C=C/c1cc2c(cc1O)[C@@H](NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2
Standard InChI: InChI=1S/C24H27NO7/c1-13(26)25-18-8-6-15-11-20(29-2)23(31-4)24(32-5)22(15)17-10-14(7-9-21(28)30-3)19(27)12-16(17)18/h7,9-12,18,27H,6,8H2,1-5H3,(H,25,26)/b9-7+/t18-/m0/s1
Standard InChI Key: RMVZSQZXNJRJFW-KOEDOTQGSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
13.4492 -7.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4492 -8.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1561 -8.4635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8677 -8.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8677 -7.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1543 -6.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5039 -6.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3084 -6.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6697 -7.6224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4869 -7.6224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9033 -8.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7205 -8.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5027 -9.0287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3236 -8.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5209 -8.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2816 -9.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8488 -9.9488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6488 -9.7561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8844 -8.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2106 -10.3495 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6148 -10.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1759 -11.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9419 -12.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5030 -12.7030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2690 -13.4860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1468 -12.2977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1561 -9.2807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4489 -9.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7400 -8.4626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0327 -8.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7414 -6.8266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0338 -7.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 6
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 2 0
4 15 1 0
15 16 1 0
16 17 2 0
18 17 1 0
18 19 2 0
19 14 1 0
18 20 1 0
17 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 2 0
3 27 1 0
27 28 1 0
2 29 1 0
29 30 1 0
1 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.48Molecular Weight (Monoisotopic): 441.1788AlogP: 3.39#Rotatable Bonds: 6Polar Surface Area: 103.32Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.86CX Basic pKa: ┄CX LogP: 2.87CX LogD: 2.86Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: 1.01
References 1. Shchegravina ES,Svirshchevskaya EV,Combes S,Allegro D,Barbier P,Gigant B,Varela PF,Gavryushin AE,Kobanova DA,Shchekotikhin AE,Fedorov AY. (2020) Discovery of dihydrofuranoallocolchicinoids - Highly potent antimitotic agents with low acute toxicity., 207 [PMID:32827941 ] [10.1016/j.ejmech.2020.112724 ]