(R)-4-((3R,5R,8R,9S,10S,13R,14S,17R)-3-(isopropylcarbamoyloxy)-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoic acid

ID: ALA4750207

PubChem CID: 156857608

Max Phase: Preclinical

Molecular Formula: C28H47NO4

Molecular Weight: 461.69

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)NC(=O)O[C@@H]1CC[C@@]2(C)[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCC(=O)O)CC[C@@H]32)C1

Standard InChI:  InChI=1S/C28H47NO4/c1-17(2)29-26(32)33-20-12-14-27(4)19(16-20)7-8-21-23-10-9-22(18(3)6-11-25(30)31)28(23,5)15-13-24(21)27/h17-24H,6-16H2,1-5H3,(H,29,32)(H,30,31)/t18-,19-,20-,21+,22-,23+,24+,27+,28-/m1/s1

Standard InChI Key:  YWQIPPURJOMWCW-CUYCEIPOSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   11.8410  -12.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8410  -13.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5463  -13.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5463  -12.3363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2516  -12.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2481  -13.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9502  -13.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6602  -13.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9571  -12.3412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6637  -12.7598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6806  -11.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9624  -11.5221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3871  -11.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3738  -12.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1484  -12.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6404  -11.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1699  -11.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3657  -13.1741    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.9500  -13.1576    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.2443  -11.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2401  -14.3793    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6558  -11.9401    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.3822  -10.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4350  -10.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2370  -10.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8981   -9.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7739  -10.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5759  -10.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1127  -11.4439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8410  -10.0549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9835  -11.2962    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1339  -13.9758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4256  -13.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7185  -13.9779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4244  -12.7511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0102  -13.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3031  -13.9799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0090  -12.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  5  9  1  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 13  1  0
 14 18  1  6
  9 19  1  6
  5 20  1  1
  6 21  1  1
 10 22  1  1
 13 23  1  1
 17 24  1  0
 24 25  1  0
 24 26  1  6
 25 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  2  0
 17 31  1  6
  2 32  1  6
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4750207

    ---

Associated Targets(non-human)

Epha2 Ephrin type-A receptor 2 (49 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.69Molecular Weight (Monoisotopic): 461.3505AlogP: 6.65#Rotatable Bonds: 6
Polar Surface Area: 75.63Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.79CX Basic pKa: CX LogP: 6.13CX LogD: 3.57
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: 1.65

References

1. Incerti M,Russo S,Corrado M,Giorgio C,Ballabeni V,Chiodelli P,Rusnati M,Scalvini L,Callegari D,Castelli R,Vacondio F,Ferlenghi F,Tognolini M,Lodola A.  (2020)  Optimization of EphA2 antagonists based on a lithocholic acid core led to the identification of UniPR505, a new 3α-carbamoyloxy derivative with antiangiogenetic properties.,  189  [PMID:32000051] [10.1016/j.ejmech.2020.112083]

Source