The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-Amino-N-benzyl-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propanamide ID: ALA4750317
PubChem CID: 162651774
Max Phase: Preclinical
Molecular Formula: C32H29F3N2OS
Molecular Weight: 546.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)NCc1ccccc1
Standard InChI: InChI=1S/C32H29F3N2OS/c33-32(34,35)26-18-16-25(17-19-26)31(39-21-29(36)30(38)37-20-22-8-2-1-3-9-22)27-12-6-4-10-23(27)14-15-24-11-5-7-13-28(24)31/h1-13,16-19,29H,14-15,20-21,36H2,(H,37,38)
Standard InChI Key: FWTKCWNUOGQBEP-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
14.4981 -5.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1944 -5.7159 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.2151 -4.8990 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.9423 -2.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5149 -3.1193 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.3318 -3.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5806 -0.6218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3936 -0.6461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2137 -2.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0560 -1.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2823 -0.9827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6657 -1.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8279 -2.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6014 -2.5882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8876 -1.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6877 -2.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2756 -2.6594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0635 -2.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2603 -1.6353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6710 -1.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6980 -3.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2706 -3.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4537 -3.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6602 -4.5124 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0642 -3.0539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0264 -4.4688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9010 -3.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2899 -4.5543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1076 -4.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5350 -3.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1437 -3.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0717 -5.9916 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.2095 -4.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7821 -5.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9652 -5.1195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5379 -5.8152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9275 -6.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7487 -6.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1723 -5.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
5 4 1 0
4 6 1 0
7 8 1 0
8 15 1 0
7 10 1 0
16 4 1 0
9 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
5 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
23 25 2 0
23 26 1 0
6 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 6 1 0
29 1 1 0
1 32 1 0
26 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.66Molecular Weight (Monoisotopic): 546.1953AlogP: 6.47#Rotatable Bonds: 7Polar Surface Area: 55.12Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.04CX LogP: 7.28CX LogD: 6.56Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -0.40
References 1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A. (2021) Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein., 215 [PMID:33640763 ] [10.1016/j.ejmech.2021.113288 ]