(R)-2-Amino-N-benzyl-3-((5-(4-(trifluoromethyl)phenyl)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-yl)thio)propanamide

ID: ALA4750317

PubChem CID: 162651774

Max Phase: Preclinical

Molecular Formula: C32H29F3N2OS

Molecular Weight: 546.66

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(CSC1(c2ccc(C(F)(F)F)cc2)c2ccccc2CCc2ccccc21)C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C32H29F3N2OS/c33-32(34,35)26-18-16-25(17-19-26)31(39-21-29(36)30(38)37-20-22-8-2-1-3-9-22)27-12-6-4-10-23(27)14-15-24-11-5-7-13-28(24)31/h1-13,16-19,29H,14-15,20-21,36H2,(H,37,38)

Standard InChI Key:  FWTKCWNUOGQBEP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   14.4981   -5.2945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1944   -5.7159    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.2151   -4.8990    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.9423   -2.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5149   -3.1193    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.3318   -3.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5806   -0.6218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3936   -0.6461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2137   -2.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0560   -1.2466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2823   -0.9827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6657   -1.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8279   -2.3281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6014   -2.5882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8876   -1.2959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6877   -2.0908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2756   -2.6594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0635   -2.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2603   -1.6353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6710   -1.0702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6980   -3.0975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2706   -3.7941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4537   -3.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6602   -4.5124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0642   -3.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0264   -4.4688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9010   -3.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2899   -4.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1076   -4.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5350   -3.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1437   -3.1601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0717   -5.9916    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.2095   -4.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7821   -5.1435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9652   -5.1195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5379   -5.8152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9275   -6.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7487   -6.5539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1723   -5.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  7  8  1  0
  8 15  1  0
  7 10  1  0
 16  4  1  0
  9  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  5 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  2  0
 23 26  1  0
  6 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  6  1  0
 29  1  1  0
  1 32  1  0
 26 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4750317

    ---

Associated Targets(Human)

KIF11 Tchem Kinesin-like protein 1 (1720 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HCT-116 (91556 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 546.66Molecular Weight (Monoisotopic): 546.1953AlogP: 6.47#Rotatable Bonds: 7
Polar Surface Area: 55.12Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.04CX LogP: 7.28CX LogD: 6.56
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.28Np Likeness Score: -0.40

References

1. Fukai R,Ogo N,Ichida T,Yamane M,Sawada JI,Miyoshi N,Murakami H,Asai A.  (2021)  Design, synthesis, and evaluation of a novel prodrug, a S-trityl--cysteine derivative targeting kinesin spindle protein.,  215  [PMID:33640763] [10.1016/j.ejmech.2021.113288]

Source