The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-chlorophenyl)-3-(isopropylamino)-1-(4-(5,6,7,8-tetrahydrobenzo[4,5]thieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl)propan-1-one ID: ALA4750379
PubChem CID: 162651232
Max Phase: Preclinical
Molecular Formula: C26H32ClN5OS
Molecular Weight: 498.10
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)NCC(C(=O)N1CCN(c2ncnc3sc4c(c23)CCCC4)CC1)c1ccc(Cl)cc1
Standard InChI: InChI=1S/C26H32ClN5OS/c1-17(2)28-15-21(18-7-9-19(27)10-8-18)26(33)32-13-11-31(12-14-32)24-23-20-5-3-4-6-22(20)34-25(23)30-16-29-24/h7-10,16-17,21,28H,3-6,11-15H2,1-2H3
Standard InChI Key: WKIJUZOVDCBRFJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
1.7589 -5.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7589 -6.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4738 -6.9236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1850 -6.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1850 -5.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4720 -5.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7940 -7.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4619 -7.8088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6459 -7.7271 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9417 -8.4673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7577 -8.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0916 -7.6263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6057 -6.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9403 -6.2193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7620 -6.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0931 -5.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6064 -4.7104 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7847 -4.7980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4496 -5.5550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9442 -3.9556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7650 -3.8692 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4567 -3.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7944 -2.5326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6154 -2.4462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9490 -1.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7699 -1.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4657 -1.0231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6392 -3.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1565 -2.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3362 -2.7928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9978 -3.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4898 -4.2143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3083 -4.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1769 -3.6357 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 2 0
4 5 1 0
5 6 1 0
1 6 1 0
7 4 1 0
7 8 2 0
9 8 1 0
3 9 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 7 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
14 19 1 0
17 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
22 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.10Molecular Weight (Monoisotopic): 497.2016AlogP: 4.65#Rotatable Bonds: 6Polar Surface Area: 61.36Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.49CX LogP: 5.45CX LogD: 3.39Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -1.87
References 1. Yu M,Zeng M,Pan Z,Wu F,Guo L,He G. (2020) Discovery of novel akt1 inhibitor induces autophagy associated death in hepatocellular carcinoma cells., 189 [PMID:32007668 ] [10.1016/j.ejmech.2020.112076 ]