The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-((2-((4-((5-Chloro-4-(((2-(N-methylmethylsulfonamido)-pyridin-3-yl)methyl)amino)pyrimidin-2-yl)amino)benzyl)amino)-3,4-dioxocyclobut-1-en-1-yl)amino)ethyl)acrylamide ID: ALA4751164
PubChem CID: 162650767
Max Phase: Preclinical
Molecular Formula: C28H30ClN9O5S
Molecular Weight: 640.13
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)NCCNc1c(NCc2ccc(Nc3ncc(Cl)c(NCc4cccnc4N(C)S(C)(=O)=O)n3)cc2)c(=O)c1=O
Standard InChI: InChI=1S/C28H30ClN9O5S/c1-4-21(39)30-12-13-31-22-23(25(41)24(22)40)33-14-17-7-9-19(10-8-17)36-28-35-16-20(29)26(37-28)34-15-18-6-5-11-32-27(18)38(2)44(3,42)43/h4-11,16,31,33H,1,12-15H2,2-3H3,(H,30,39)(H2,34,35,36,37)
Standard InChI Key: COBUBKXVXDHVBG-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
5.7449 -9.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5447 -12.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8260 -7.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1017 -9.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6211 -10.6273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4350 -8.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2420 -9.7348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2227 -11.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7207 -8.6983 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.1469 -10.7039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9573 -6.9198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4038 -11.3819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1863 -9.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5283 -6.9614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6841 -7.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0423 -9.9515 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.7104 -9.9996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6201 -9.4285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1394 -8.0900 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7937 -11.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7083 -8.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4717 -9.9136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1517 -8.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2550 -7.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8661 -8.4812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1760 -9.4771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9710 -10.6796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3970 -7.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0670 -10.7793 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8299 -9.1501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8934 -9.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2793 -8.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8180 -11.9945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4250 -8.2619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6557 -8.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8504 -8.2182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.2299 -11.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4960 -10.7377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6627 -12.0562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0469 -7.5225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2470 -11.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0994 -7.0030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0060 -8.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3647 -11.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34 9 1 0
24 11 2 0
21 43 1 0
14 3 1 0
37 12 1 0
37 39 2 0
25 35 1 0
38 8 2 0
38 20 1 0
32 24 1 0
27 10 1 0
3 42 2 0
3 36 1 0
25 19 1 0
16 7 2 0
35 31 1 0
17 4 1 0
20 33 2 0
22 38 1 0
23 34 1 0
23 26 1 0
24 14 1 0
16 1 1 0
12 27 1 0
21 15 2 0
35 40 2 0
43 32 2 0
33 2 1 0
34 28 2 0
6 21 1 0
41 8 1 0
10 17 1 0
5 13 2 0
30 16 2 0
20 29 1 0
36 23 2 0
2 41 2 0
29 44 1 0
16 29 1 0
4 31 1 0
19 6 1 0
26 22 1 0
37 5 1 0
31 18 2 0
11 15 1 0
4 25 2 0
28 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 640.13Molecular Weight (Monoisotopic): 639.1779AlogP: 2.20#Rotatable Bonds: 15Polar Surface Area: 187.41Molecular Species: NEUTRALHBA: 12HBD: 5#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.49CX Basic pKa: 4.54CX LogP: 1.42CX LogD: 1.42Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.07Np Likeness Score: -1.23
References 1. Li B,Li Y,Tomkiewicz-Raulet C,Dao P,Lietha D,Yen-Pon E,Du Z,Coumoul X,Garbay C,Etheve-Quelquejeu M,Chen H. (2020) Design, Synthesis, and Biological Evaluation of Covalent Inhibitors of Focal Adhesion Kinase (FAK) against Human Malignant Glioblastoma., 63 (21): [PMID:33119295 ] [10.1021/acs.jmedchem.0c01059 ]