The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(1,3-Dioxoisoindolin-2-yl)-N-hydroxy-2-phenylhexanamide ID: ALA4751174
PubChem CID: 162650853
Max Phase: Preclinical
Molecular Formula: C20H20N2O4
Molecular Weight: 352.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NO)C(CCCCN1C(=O)c2ccccc2C1=O)c1ccccc1
Standard InChI: InChI=1S/C20H20N2O4/c23-18(21-26)15(14-8-2-1-3-9-14)10-6-7-13-22-19(24)16-11-4-5-12-17(16)20(22)25/h1-5,8-9,11-12,15,26H,6-7,10,13H2,(H,21,23)
Standard InChI Key: LLDNEJXFPFQOOV-UHFFFAOYSA-N
Molfile:
RDKit 2D
26 28 0 0 0 0 0 0 0 0999 V2000
30.5863 -3.2271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2928 -2.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0017 -3.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7082 -2.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4171 -3.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1236 -2.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8325 -3.2144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1212 -1.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8330 -1.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8309 -0.7653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1214 -0.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4126 -0.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4182 -1.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8350 -4.0316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5390 -2.8037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.2479 -3.2102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8425 -2.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5070 -4.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7083 -4.2136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2987 -3.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4840 -3.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0780 -4.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4926 -4.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3059 -4.9190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1146 -4.5878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6697 -2.0956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
7 15 1 0
15 16 1 0
1 17 1 0
17 20 1 0
19 18 1 0
18 1 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
18 25 2 0
17 26 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 352.39Molecular Weight (Monoisotopic): 352.1423AlogP: 2.74#Rotatable Bonds: 7Polar Surface Area: 86.71Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.83CX Basic pKa: ┄CX LogP: 2.68CX LogD: 2.66Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.35Np Likeness Score: -0.48
References 1. Mak JYW,Wu KC,Gupta PK,Barbero S,McLaughlin MG,Lucke AJ,Tng J,Lim J,Loh Z,Sweet MJ,Reid RC,Liu L,Fairlie DP. (2021) HDAC7 Inhibition by Phenacetyl and Phenylbenzoyl Hydroxamates., 64 (4.0): [PMID:33570940 ] [10.1021/acs.jmedchem.0c01967 ]