NA

ID: ALA4751254

Max Phase: Preclinical

Molecular Formula: C27H32FN7O3

Molecular Weight: 521.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCNC(=O)COc2ccc(F)cc2C(=O)N2CCCC[C@H]2c2cc3nc([C@H]4C[C@H](N)C4)cc1n3n2

Standard InChI:  InChI=1S/C27H32FN7O3/c1-33-9-7-30-25(36)15-38-23-6-5-17(28)12-19(23)27(37)34-8-3-2-4-22(34)21-13-24-31-20(16-10-18(29)11-16)14-26(33)35(24)32-21/h5-6,12-14,16,18,22H,2-4,7-11,15,29H2,1H3,(H,30,36)/t16-,18-,22-/m0/s1

Standard InChI Key:  XTQFQCDOONDMIK-ZJBJCVSYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   17.5779  -17.0372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2589  -17.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3686  -20.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3686  -20.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0739  -21.2594    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0739  -19.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7791  -20.0377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7837  -20.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5632  -21.1045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0405  -20.4398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5559  -19.7806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8554  -20.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2667  -21.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0803  -21.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4888  -20.4314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0775  -19.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2577  -19.7251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6622  -21.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8726  -21.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6622  -21.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4519  -22.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0739  -18.8078    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3662  -18.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8459  -19.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2513  -18.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0287  -19.0229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0683  -18.3077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4736  -17.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0617  -16.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2403  -16.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8387  -17.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0216  -17.6144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1809  -17.7804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6406  -18.3114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2908  -17.5956    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.4392  -21.1397    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.3827  -18.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8686  -16.6788    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9551  -22.2551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  1  0
  3  6  2  0
  4  5  2  0
  5  8  1  0
  7  6  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 10 12  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 18  1  0
 18  4  1  1
  6 22  1  0
 22 34  1  0
 22 23  1  0
 17 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 31 32  1  0
  1 33  1  0
 33 34  1  0
 28 35  1  0
 12 36  1  6
 32 37  1  0
 37  2  1  0
  2  1  1  0
  2 38  2  0
 20 39  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4751254

    ---

Associated Targets(non-human)

F Fusion glycoprotein F0 (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.60Molecular Weight (Monoisotopic): 521.2551AlogP: 2.39#Rotatable Bonds: 1
Polar Surface Area: 118.09Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.31CX Basic pKa: 10.06CX LogP: 1.59CX LogD: -0.92
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.50Np Likeness Score: -0.77

References

1. Yamaguchi-Sasaki T,Kawaguchi T,Okada A,Tokura S,Tanaka-Yamamoto N,Takeuchi T,Ogata Y,Takahashi R,Kurimoto-Tsuruta R,Tamaoki T,Sugaya Y,Abe-Kumasaka T,Arikawa K,Yoshida I,Sugiyama H,Kanuma K,Yoshinaga M.  (2020)  Discovery of a potent dual inhibitor of wild-type and mutant respiratory syncytial virus fusion proteins through the modulation of atropisomer interconversion properties.,  28  (24): [PMID:33190073] [10.1016/j.bmc.2020.115818]

Source