The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Feruloyl-N'-cis-feruloylputrescine ID: ALA4751258
PubChem CID: 102476222
Max Phase: Preclinical
Molecular Formula: C24H28N2O6
Molecular Weight: 440.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C\C(=O)NCCCCNC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O
Standard InChI: InChI=1S/C24H28N2O6/c1-31-21-15-17(5-9-19(21)27)7-11-23(29)25-13-3-4-14-26-24(30)12-8-18-6-10-20(28)22(16-18)32-2/h5-12,15-16,27-28H,3-4,13-14H2,1-2H3,(H,25,29)(H,26,30)/b11-7-,12-8+
Standard InChI Key: CHEMZHJQHCVLFI-NTLHZVPKSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
2.7819 -20.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7807 -21.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4955 -22.0398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2119 -21.6265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2091 -20.7959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4937 -20.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0673 -20.3873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4912 -19.5618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2044 -19.1472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9270 -22.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6408 -21.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3559 -22.0355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0698 -21.6219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3573 -22.8605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7848 -22.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4987 -21.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2137 -22.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9276 -21.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6426 -22.0289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3565 -21.6152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0716 -22.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3552 -20.7903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7854 -21.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7841 -20.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4999 -20.3776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4990 -19.5534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7834 -19.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0672 -19.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0716 -20.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3506 -19.1504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3465 -18.3254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7810 -18.3162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
6 8 1 0
8 9 1 0
4 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
30 31 1 0
27 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.50Molecular Weight (Monoisotopic): 440.1947AlogP: 2.85#Rotatable Bonds: 11Polar Surface Area: 117.12Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.59CX Basic pKa: ┄CX LogP: 2.59CX LogD: 2.59Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: 0.15
References 1. Roulier B,Pérès B,Haudecoeur R. (2020) Advances in the Design of Genuine Human Tyrosinase Inhibitors for Targeting Melanogenesis and Related Pigmentations., 63 (22.0): [PMID:32787103 ] [10.1021/acs.jmedchem.0c00994 ]