N-((R)-Carbamoylphenylmethyl)-N-[(R)-1-(2,3,5-trifluorophenyl)ethyl]benzamide

ID: ALA4751372

PubChem CID: 118247003

Max Phase: Preclinical

Molecular Formula: C23H19F3N2O2

Molecular Weight: 412.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H](c1cc(F)cc(F)c1F)N(C(=O)c1ccccc1)[C@@H](C(N)=O)c1ccccc1

Standard InChI:  InChI=1S/C23H19F3N2O2/c1-14(18-12-17(24)13-19(25)20(18)26)28(23(30)16-10-6-3-7-11-16)21(22(27)29)15-8-4-2-5-9-15/h2-14,21H,1H3,(H2,27,29)/t14-,21-/m1/s1

Standard InChI Key:  HZNMBIXVTRMYDZ-SPLOXXLWSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   24.2914   -1.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2903   -2.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0025   -2.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7163   -2.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7134   -1.5565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0007   -1.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0023   -3.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2903   -4.0266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7140   -4.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4259   -3.6185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.7138   -4.8482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5786   -3.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8667   -4.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1582   -3.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4508   -4.0218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4502   -4.8440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1628   -5.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8713   -4.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5788   -2.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2901   -4.8479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5782   -5.2604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.8707   -5.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6577   -6.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2334   -6.7936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0249   -6.5823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2335   -5.7866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6563   -5.2150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1598   -2.7968    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.7434   -3.6127    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.1644   -6.0739    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  3  1  6
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  2  0
  8 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 12 19  1  1
  8 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 14 28  1  0
 15 29  1  0
 17 30  1  0
M  END

Associated Targets(Human)

TRPM8 Tclin Transient receptor potential cation channel subfamily M member 8 (1168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.41Molecular Weight (Monoisotopic): 412.1399AlogP: 4.53#Rotatable Bonds: 6
Polar Surface Area: 63.40Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.45CX LogD: 4.45
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.60Np Likeness Score: -1.14

References

1. Kobayashi JI,Hirasawa H,Fujimori Y,Nakanishi O,Kamada N,Ikeda T,Yamamoto A,Kanbe H.  (2021)  Identification of N-acyl-N-indanyl-α-phenylglycinamides as selective TRPM8 antagonists designed to mitigate the risk of adverse effects.,  30  [PMID:33333445] [10.1016/j.bmc.2020.115903]

Source