The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-((7-(3-(Cyclopentylamino)propoxy)-6-methoxyquinazolin-4-yl)amino)pyrimidin-2-yl)-1-methyl-1H-pyrrole-2-carboxamide ID: ALA4751475
PubChem CID: 162651933
Max Phase: Preclinical
Molecular Formula: C27H32N8O3
Molecular Weight: 516.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(Nc3cnc(NC(=O)c4cccn4C)nc3)ncnc2cc1OCCCNC1CCCC1
Standard InChI: InChI=1S/C27H32N8O3/c1-35-11-5-9-22(35)26(36)34-27-29-15-19(16-30-27)33-25-20-13-23(37-2)24(14-21(20)31-17-32-25)38-12-6-10-28-18-7-3-4-8-18/h5,9,11,13-18,28H,3-4,6-8,10,12H2,1-2H3,(H,31,32,33)(H,29,30,34,36)
Standard InChI Key: BNEVROJYJXVARX-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
25.6466 -3.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4679 -3.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7264 -2.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0593 -1.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3964 -2.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9516 -3.6994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7685 -3.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2481 -4.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0650 -4.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5487 -4.8579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3656 -4.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8450 -5.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5070 -3.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6925 -4.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9953 -4.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6583 -5.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1338 -6.0197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9504 -5.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2891 -5.1820 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8074 -4.5235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2096 -3.3621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5392 -2.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1413 -3.7735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.9583 -3.6897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4379 -4.3507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2542 -4.2673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5888 -3.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1052 -2.8527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.2906 -2.9394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4057 -3.4319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7428 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5597 -2.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2588 -2.0200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.1092 -3.2064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8560 -2.8745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7711 -2.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9678 -1.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9392 -4.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
2 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 16 1 0
15 13 1 0
13 14 2 0
14 11 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 2 0
14 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 32 2 0
34 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.61Molecular Weight (Monoisotopic): 516.2597AlogP: 4.06#Rotatable Bonds: 11Polar Surface Area: 128.11Molecular Species: BASEHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.32CX Basic pKa: 10.45CX LogP: 3.27CX LogD: 0.43Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.18
References 1. Nissink JWM,Bazzaz S,Blackett C,Clark MA,Collingwood O,Disch JS,Gikunju D,Goldberg K,Guilinger JP,Hardaker E,Hennessy EJ,Jetson R,Keefe AD,McCoull W,McMurray L,Olszewski A,Overman R,Pflug A,Preston M,Rawlins PB,Rivers E,Schimpl M,Smith P,Truman C,Underwood E,Warwicker J,Winter-Holt J,Woodcock S,Zhang Y. (2021) Generating Selective Leads for Mer Kinase Inhibitors-Example of a Comprehensive Lead-Generation Strategy., 64 (6.0): [PMID:33683117 ] [10.1021/acs.jmedchem.0c01904 ]