4-(2,4-difluoro-3'-hydroxy-[1,1'-biphenyl]-3-carboxamido)-N-(4-fluorophenyl)-1H-pyrazole-3-carboxamide

ID: ALA4751481

PubChem CID: 162651940

Max Phase: Preclinical

Molecular Formula: C23H15F3N4O3

Molecular Weight: 452.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(F)cc1)c1n[nH]cc1NC(=O)c1c(F)ccc(-c2cccc(O)c2)c1F

Standard InChI:  InChI=1S/C23H15F3N4O3/c24-13-4-6-14(7-5-13)28-23(33)21-18(11-27-30-21)29-22(32)19-17(25)9-8-16(20(19)26)12-2-1-3-15(31)10-12/h1-11,31H,(H,27,30)(H,28,33)(H,29,32)

Standard InChI Key:  OHPGMZBNBHNXPV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   23.4412  -22.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4401  -22.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1481  -23.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8578  -22.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8550  -22.0935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1464  -21.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5662  -23.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5674  -24.1409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2732  -22.9140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9816  -23.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0664  -24.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8660  -24.3008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.2735  -23.5924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7257  -22.9861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8931  -22.1862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6694  -21.9312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.2840  -21.6413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5611  -21.6823    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.4514  -20.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2271  -20.5908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3947  -19.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7853  -19.2460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0057  -19.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8419  -20.3032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9516  -18.4459    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.1479  -24.1428    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.7340  -23.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0263  -22.9141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3187  -23.3215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3177  -24.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0300  -24.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7346  -24.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6116  -22.9120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
  5 18  1  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
  3 26  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
  2 27  1  0
 29 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4751481

    ---

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1/cyclin B1 (1887 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK2 Tchem CDK2/Cyclin A2 (2260 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A2058 (690 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.39Molecular Weight (Monoisotopic): 452.1096AlogP: 4.70#Rotatable Bonds: 5
Polar Surface Area: 107.11Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.15CX Basic pKa: CX LogP: 4.62CX LogD: 4.61
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -1.28

References

1. Lin T,Li J,Liu L,Li Y,Jiang H,Chen K,Xu P,Luo C,Zhou B.  (2021)  Design, synthesis, and biological evaluation of 4-benzoylamino-1H-pyrazole-3-carboxamide derivatives as potent CDK2 inhibitors.,  215  [PMID:33611192] [10.1016/j.ejmech.2021.113281]

Source