2-[2-[[3-[4-chloro-2-fluoro-5-[[(3R)-3-piperidyl]oxy]phenyl]-2-fluoro-benzoyl]amino]-5-fluoro-phenyl]acetic acid

ID: ALA4751488

PubChem CID: 154585554

Max Phase: Preclinical

Molecular Formula: C26H22ClF3N2O4

Molecular Weight: 518.92

Molecule Type: Unknown

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)Cc1cc(F)ccc1NC(=O)c1cccc(-c2cc(O[C@@H]3CCCNC3)c(Cl)cc2F)c1F

Standard InChI:  InChI=1S/C26H22ClF3N2O4/c27-20-12-21(29)19(11-23(20)36-16-3-2-8-31-13-16)17-4-1-5-18(25(17)30)26(35)32-22-7-6-15(28)9-14(22)10-24(33)34/h1,4-7,9,11-12,16,31H,2-3,8,10,13H2,(H,32,35)(H,33,34)/t16-/m1/s1

Standard InChI Key:  MOOARNYDOKGVQG-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   25.3024  -25.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3013  -26.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0161  -26.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7325  -26.4933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7297  -25.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0143  -25.2535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0178  -27.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3016  -28.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3010  -28.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0159  -29.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7328  -28.9620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7299  -28.1392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4425  -25.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1586  -25.6574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.4395  -24.4225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0169  -30.2037    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.8714  -25.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5859  -25.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2983  -25.2408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2957  -24.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5746  -24.0053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8652  -24.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5870  -26.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3020  -26.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3030  -27.7169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.0159  -26.4785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4487  -29.3722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1617  -28.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8721  -29.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5831  -28.9600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5846  -28.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8689  -27.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1517  -28.1354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0080  -23.9989    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   24.5876  -27.7276    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.4477  -26.9046    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3  7  1  0
  5 13  1  0
 13 14  1  0
 13 15  2  0
 10 16  1  0
 14 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 18 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 11 27  1  0
 28 27  1  6
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 20 34  1  0
  8 35  1  0
  4 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4751488

    ---

Associated Targets(Human)

SUCNR1 Tchem Succinate receptor 1 (78 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Sucnr1 Succinate receptor 1 (1 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Sucnr1 Succinate receptor 1 (7 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.92Molecular Weight (Monoisotopic): 518.1220AlogP: 5.43#Rotatable Bonds: 7
Polar Surface Area: 87.66Molecular Species: ZWITTERIONHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.48CX Basic pKa: 9.43CX LogP: 2.85CX LogD: 2.85
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -0.97

References

1. Velcicky J,Wilcken R,Cotesta S,Janser P,Schlapbach A,Wagner T,Piechon P,Villard F,Bouhelal R,Piller F,Harlfinger S,Stringer R,Fehlmann D,Kaupmann K,Littlewood-Evans A,Haffke M,Gommermann N.  (2020)  Discovery and Optimization of Novel SUCNR1 Inhibitors: Design of Zwitterionic Derivatives with a Salt Bridge for the Improvement of Oral Exposure.,  63  (17): [PMID:32856916] [10.1021/acs.jmedchem.0c01020]

Source