3,5-dichloro-N-[3-chloro-4-(3,5-dihydroxyphenoxy)phenyl]-2-hydroxy-benzamide

ID: ALA4751500

PubChem CID: 162652130

Max Phase: Preclinical

Molecular Formula: C19H12Cl3NO5

Molecular Weight: 440.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2cc(O)cc(O)c2)c(Cl)c1)c1cc(Cl)cc(Cl)c1O

Standard InChI:  InChI=1S/C19H12Cl3NO5/c20-9-3-14(18(26)16(22)4-9)19(27)23-10-1-2-17(15(21)5-10)28-13-7-11(24)6-12(25)8-13/h1-8,24-26H,(H,23,27)

Standard InChI Key:  PZIMSFYWCFYPLQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   15.0528  -27.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0536  -28.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7662  -28.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4745  -28.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4698  -27.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7606  -27.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1879  -28.7585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8981  -28.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6088  -28.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3185  -28.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3158  -27.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5974  -27.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8905  -27.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6091  -29.5787    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.0255  -27.1081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7394  -27.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4491  -27.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7437  -28.3343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1574  -27.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8666  -27.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8628  -26.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1438  -25.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4417  -26.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7261  -25.8770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1367  -25.0439    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   23.5804  -27.5015    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.3461  -28.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7574  -26.3017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  9 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 23 24  1  0
 22 25  1  0
 20 26  1  0
  2 27  1  0
  6 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4751500

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.67Molecular Weight (Monoisotopic): 438.9781AlogP: 5.81#Rotatable Bonds: 4
Polar Surface Area: 99.02Molecular Species: ACIDHBA: 5HBD: 4
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.95CX Basic pKa: CX LogP: 5.47CX LogD: 4.09
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.41Np Likeness Score: -0.73

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source