The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R)-2-([(5Sa)-5-(3-Chloro-2-methyl-4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl)-6-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy)-3-phenylpropanoic acid ID: ALA4751503
PubChem CID: 162652132
Max Phase: Preclinical
Molecular Formula: C35H34ClFN4O4S
Molecular Weight: 661.20
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(-c2c(-c3ccc(F)cc3)sc3ncnc(O[C@H](Cc4ccccc4)C(=O)O)c23)ccc(OCCN2CCN(C)CC2)c1Cl
Standard InChI: InChI=1S/C35H34ClFN4O4S/c1-22-26(12-13-27(31(22)36)44-19-18-41-16-14-40(2)15-17-41)29-30-33(45-28(35(42)43)20-23-6-4-3-5-7-23)38-21-39-34(30)46-32(29)24-8-10-25(37)11-9-24/h3-13,21,28H,14-20H2,1-2H3,(H,42,43)/t28-/m1/s1
Standard InChI Key: JCLDDGHQXBGBSK-MUUNZHRXSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
24.8280 -24.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8268 -24.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5349 -25.2531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2446 -24.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2417 -24.0210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5331 -23.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9529 -25.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9542 -26.0683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6625 -26.4758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2471 -26.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5388 -26.0705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2484 -27.2952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6638 -27.2930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9582 -27.6998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9591 -28.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6680 -28.9246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3730 -27.6954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3814 -28.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1563 -28.7504 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.6269 -28.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1427 -27.4365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3847 -26.6601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1836 -26.4830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4281 -25.7041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8748 -25.1015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0737 -25.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8329 -26.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7360 -27.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2258 -25.5263 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
30.1183 -24.3214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9155 -24.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4694 -24.7431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2667 -24.5638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8208 -25.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6150 -24.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8626 -24.2122 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3095 -23.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5089 -23.7856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6606 -24.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4402 -28.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8555 -28.7844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6719 -28.7763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0739 -28.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6536 -27.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8386 -27.3697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8911 -28.0543 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
8 7 1 1
8 9 1 0
8 10 1 0
10 11 1 0
10 12 2 0
9 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 18 1 0
17 13 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 17 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
22 27 1 0
21 22 1 0
23 28 1 0
24 29 1 0
25 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
36 39 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 40 1 0
20 40 1 0
43 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 661.20Molecular Weight (Monoisotopic): 660.1973AlogP: 6.83#Rotatable Bonds: 11Polar Surface Area: 88.02Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.90CX Basic pKa: 7.68CX LogP: 4.99CX LogD: 4.85Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.17Np Likeness Score: -0.91
References 1. Szlavik Z,Csekei M,Paczal A,Szabo ZB,Sipos S,Radics G,Proszenyak A,Balint B,Murray J,Davidson J,Chen I,Dokurno P,Surgenor AE,Daniels ZM,Hubbard RE,Le Toumelin-Braizat G,Claperon A,Lysiak-Auvity G,Girard AM,Bruno A,Chanrion M,Colland F,Maragno AL,Demarles D,Geneste O,Kotschy A. (2020) Discovery of S64315, a Potent and Selective Mcl-1 Inhibitor., 63 (22): [PMID:33146521 ] [10.1021/acs.jmedchem.0c01234 ]