N-(3-chlorophenyl)-3-(4-(1-methyl-1H-imidazol-5-yl)-1H-1,2,3-triazol-1-yl)benzamide

ID: ALA4751520

PubChem CID: 146294019

Max Phase: Preclinical

Molecular Formula: C19H15ClN6O

Molecular Weight: 378.82

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cncc1-c1cn(-c2cccc(C(=O)Nc3cccc(Cl)c3)c2)nn1

Standard InChI:  InChI=1S/C19H15ClN6O/c1-25-12-21-10-18(25)17-11-26(24-23-17)16-7-2-4-13(8-16)19(27)22-15-6-3-5-14(20)9-15/h2-12H,1H3,(H,22,27)

Standard InChI Key:  LKJCXELXJGTDQD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    5.8840  -18.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8829  -19.0495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5909  -19.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3006  -19.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2977  -18.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5891  -17.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0094  -19.4541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0962  -20.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8958  -20.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3033  -19.7269    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7554  -19.1206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2301  -21.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8227  -21.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3704  -22.4955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1165  -22.1619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0297  -21.3493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6361  -20.8015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1748  -19.4575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4674  -19.0483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1742  -20.2747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4662  -20.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7605  -20.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0530  -20.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0519  -21.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7642  -21.9052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4689  -21.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7665  -22.7224    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  7  1  0
  4  7  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
  9 12  1  0
 16 17  1  0
  2 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4751520

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 378.82Molecular Weight (Monoisotopic): 378.0996AlogP: 3.57#Rotatable Bonds: 4
Polar Surface Area: 77.63Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.29CX LogP: 3.43CX LogD: 3.43
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: -2.18

References

1.  (2020)  Triazole benzamide derivatives as gpr142 agonists, 

Source