Ethyl 2-(4-(1-(4-fluorophenyl)-5-methyl-4-oxo-4,5-dihydro-1H-pyrazolo[3,4-d]pyrimidin-6-yl)phenoxy)propanoate

ID: ALA4751733

PubChem CID: 162652929

Max Phase: Preclinical

Molecular Formula: C23H21FN4O4

Molecular Weight: 436.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)C(C)Oc1ccc(-c2nc3c(cnn3-c3ccc(F)cc3)c(=O)n2C)cc1

Standard InChI:  InChI=1S/C23H21FN4O4/c1-4-31-23(30)14(2)32-18-11-5-15(6-12-18)20-26-21-19(22(29)27(20)3)13-25-28(21)17-9-7-16(24)8-10-17/h5-14H,4H2,1-3H3

Standard InChI Key:  QIRQYEFCARSTPC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   30.9268  -11.4005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9256  -12.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6415  -12.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3590  -12.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3562  -11.3969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6397  -10.9853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0671  -10.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7845  -11.3945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7732   -9.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0626  -10.1584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.4911  -10.1512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4941  -10.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2792  -11.2262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.7631  -10.5609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2745   -9.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5372  -12.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9839  -12.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2399  -13.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0489  -13.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6014  -12.9593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3424  -12.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7672   -8.9178    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2098  -12.6386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.4946  -12.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7787  -12.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0676  -12.2261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3518  -12.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7781  -13.4630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.3107  -14.3608    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.4952  -11.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3492   -9.7514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6418  -12.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8 12  1  0
 11  9  1  0
  9 10  1  0
 10  7  1  0
  5  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  9 22  2  0
  2 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  2  0
 19 29  1  0
 24 30  1  0
 10 31  1  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4751733

    ---

Associated Targets(non-human)

L6 (7924 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.44Molecular Weight (Monoisotopic): 436.1547AlogP: 3.26#Rotatable Bonds: 6
Polar Surface Area: 88.24Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.56CX LogD: 3.56
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.81

References

1. Gupta S,Rai AK,Pandey S,Singh LR,Kant R,Tamrakar AK,Sashidhara KV.  (2021)  Microwave-assisted efficient synthesis of pyrazole-fibrate derivatives as stimulators of glucose uptake in skeletal muscle cells.,  34  [PMID:33359606] [10.1016/j.bmcl.2020.127760]

Source