7-(pyridin-4-yl)-4-(3-(trifluoromethyl)benzylsulfonyl)-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepine

ID: ALA4751751

PubChem CID: 162653028

Max Phase: Preclinical

Molecular Formula: C22H19F3N2O3S

Molecular Weight: 448.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(Cc1cccc(C(F)(F)F)c1)N1CCOc2ccc(-c3ccncc3)cc2C1

Standard InChI:  InChI=1S/C22H19F3N2O3S/c23-22(24,25)20-3-1-2-16(12-20)15-31(28,29)27-10-11-30-21-5-4-18(13-19(21)14-27)17-6-8-26-9-7-17/h1-9,12-13H,10-11,14-15H2

Standard InChI Key:  XCFWDWZDUYRYOZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   34.9824   -4.1850    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.9865   -5.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6922   -4.5900    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   31.5320   -4.9527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.5362   -4.1355    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.8264   -4.5405    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.1504   -2.3690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1493   -3.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8573   -3.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8555   -1.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4431   -3.5968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7355   -3.1860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0279   -3.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0268   -4.4114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7392   -4.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4438   -4.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5689   -3.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5641   -2.3654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2051   -1.8445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2189   -3.6953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0096   -2.0171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0219   -3.5041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3709   -2.7564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3450   -4.0070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8613   -4.6404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5682   -5.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0838   -6.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8914   -5.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1808   -5.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6634   -4.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5056   -5.6353    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  2  0
  6  5  2  0
  7  8  2  0
  8  9  1  0
  9 17  2  0
 18 10  2  0
 10  7  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 11  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 19 21  1  0
 20 22  1  0
 21 23  1  0
 22 23  1  0
 22  5  1  0
  5 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 29  2  1  0
  2 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4751751

    ---

Associated Targets(Human)

GPR142 Tchem Probable G-protein coupled receptor 142 (378 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gpr142 Probable G-protein coupled receptor 142 (77 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.47Molecular Weight (Monoisotopic): 448.1068AlogP: 4.49#Rotatable Bonds: 4
Polar Surface Area: 59.50Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.16CX LogP: 3.49CX LogD: 3.49
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.59Np Likeness Score: -1.67

References

1. Wilson JE,Kurukulasuriya R,Sinz C,Lombardo M,Bender K,Parker D,Sherer EC,Costa M,Dingley K,Li X,Mitelman S,Tong S,Bugianesi R,Ehrhardt A,Priest B,Ratliff K,Ujjainwalla F,Nargund R,Hagmann WK,Edmondson S.  (2016)  Discovery and development of benzo-[1,2,4]-triazolo-[1,4]-oxazepine GPR142 agonists for the treatment of diabetes.,  26  (12.0): [PMID:27240550] [10.1016/j.bmcl.2016.04.018]

Source