3-((5-chlorobenzofuran-2-yl)(phenyl)methyl)-2-methyl-1H-indole

ID: ALA4751764

PubChem CID: 162653262

Max Phase: Preclinical

Molecular Formula: C24H18ClNO

Molecular Weight: 371.87

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1[nH]c2ccccc2c1C(c1ccccc1)c1cc2cc(Cl)ccc2o1

Standard InChI:  InChI=1S/C24H18ClNO/c1-15-23(19-9-5-6-10-20(19)26-15)24(16-7-3-2-4-8-16)22-14-17-13-18(25)11-12-21(17)27-22/h2-14,24,26H,1H3

Standard InChI Key:  CSDLYVYNQUSVRC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
   14.3531  -10.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3519  -11.2531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0600  -11.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0582  -10.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7668  -10.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7716  -11.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5516  -11.4971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0290  -10.8319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5439  -10.1725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8462  -10.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2589  -11.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2506  -10.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5182   -8.8253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9142   -9.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8520  -12.2412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2641  -12.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0821  -12.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4863  -12.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0719  -11.5247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2283   -9.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0617  -10.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6682  -10.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4414  -10.3128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6048   -9.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9970   -8.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6453  -10.0252    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   17.1138   -9.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 21  1  0
 20 13  1  0
 13 14  1  0
 14 12  2  0
 11 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 11  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  1 26  1  0
 14 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4751764

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
C-33-A (287 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 371.87Molecular Weight (Monoisotopic): 371.1077AlogP: 7.06#Rotatable Bonds: 3
Polar Surface Area: 28.93Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.39CX LogD: 6.39
Aromatic Rings: 5Heavy Atoms: 27QED Weighted: 0.36Np Likeness Score: -0.63

References

1. Siddiqui SK,SahayaSheela VJ,Kolluru S,Pandian GN,Santhoshkumar TR,Dan VM,Ramana CV.  (2020)  Discovery of 3-(benzofuran-2-ylmethyl)-1H-indole derivatives as potential autophagy inducers in cervical cancer cells.,  30  (19): [PMID:32769048] [10.1016/j.bmcl.2020.127431]

Source