N-(4-amino-3-nitrophenyl)benzenesulfonamide

ID: ALA4751828

PubChem CID: 8452407

Max Phase: Preclinical

Molecular Formula: C12H11N3O4S

Molecular Weight: 293.30

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ccc(NS(=O)(=O)c2ccccc2)cc1[N+](=O)[O-]

Standard InChI:  InChI=1S/C12H11N3O4S/c13-11-7-6-9(8-12(11)15(16)17)14-20(18,19)10-4-2-1-3-5-10/h1-8,14H,13H2

Standard InChI Key:  GQTSATIPZYKDAN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   31.5650  -16.2406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1606  -15.5349    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   30.7516  -16.2380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5789  -15.5349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5778  -16.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2858  -16.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9955  -16.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9927  -15.5313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2840  -15.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8711  -15.1264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.4557  -15.1268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4591  -14.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7522  -13.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0436  -14.3094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0464  -15.1309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7540  -15.5355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7038  -16.7614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2877  -17.5851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9953  -17.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.5799  -17.9935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
 10  2  1  0
  2 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 17  1  0
 18 19  2  0
 18 20  1  0
  6 18  1  0
M  CHG  2  18   1  20  -1
M  END

Alternative Forms

Associated Targets(Human)

FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 293.30Molecular Weight (Monoisotopic): 293.0470AlogP: 1.98#Rotatable Bonds: 4
Polar Surface Area: 115.33Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.93CX Basic pKa: 0.98CX LogP: 2.22CX LogD: 2.12
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.51Np Likeness Score: -1.96

References

1. Xu F,Zhao Y,Zhou H,Li C,Zhang X,Hou T,Qu L,Wei L,Wang J,Liu Y,Liang X.  (2020)  Synthesis and evaluation of 3-(4-(phenoxymethyl)phenyl)propanoic acid and N-phenylbenzenesulfonamide derivatives as FFA4 agonists.,  30  (24): [PMID:33127539] [10.1016/j.bmcl.2020.127650]

Source