The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[[2-(4-hydroxyanilino)-2-oxo-ethyl]sulfamoyl]-N-(2-pyrrolidin-1-ylethyl)benzamide ID: ALA4751896
PubChem CID: 146623978
Max Phase: Preclinical
Molecular Formula: C21H26N4O5S
Molecular Weight: 446.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNS(=O)(=O)c1ccccc1C(=O)NCCN1CCCC1)Nc1ccc(O)cc1
Standard InChI: InChI=1S/C21H26N4O5S/c26-17-9-7-16(8-10-17)24-20(27)15-23-31(29,30)19-6-2-1-5-18(19)21(28)22-11-14-25-12-3-4-13-25/h1-2,5-10,23,26H,3-4,11-15H2,(H,22,28)(H,24,27)
Standard InChI Key: CKYGMFLSYPZZTI-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
6.7659 -7.1703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2371 -6.4931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4136 -6.4227 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.2735 -6.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2724 -7.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9871 -8.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7036 -7.6684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7008 -6.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9853 -6.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9829 -5.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6961 -5.1891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2672 -5.1934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4105 -5.5977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1234 -5.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8394 -5.5923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8425 -6.4173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5523 -5.1771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2683 -5.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2669 -6.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9820 -6.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6959 -6.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6901 -5.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9744 -5.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4125 -6.8127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2647 -4.3685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5490 -3.9581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5466 -3.1331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2156 -2.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9584 -1.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1333 -1.8628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8808 -2.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
1 3 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
9 10 1 0
10 11 2 0
10 12 1 0
8 3 1 0
3 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
12 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.53Molecular Weight (Monoisotopic): 446.1624AlogP: 1.13#Rotatable Bonds: 9Polar Surface Area: 127.84Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.17CX Basic pKa: 8.13CX LogP: 0.60CX LogD: 0.06Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.43Np Likeness Score: -1.79
References 1. Bazan HA,Bhattacharjee S,Burgos C,Recio J,Abet V,Pahng AR,Jun B,Heap J,Ledet AJ,Gordon WC,Edwards S,Paul D,Alvarez-Builla J,Bazan NG. (2020) A novel pipeline of 2-(benzenesulfonamide)-N-(4-hydroxyphenyl) acetamide analgesics that lack hepatotoxicity and retain antipyresis., 202 [PMID:32629335 ] [10.1016/j.ejmech.2020.112600 ]