N-(benzo[d][1,3]dioxol-5-ylmethyl)-3-chloro-4-morpholinoaniline

ID: ALA4751900

PubChem CID: 631411

Max Phase: Preclinical

Molecular Formula: C18H19ClN2O3

Molecular Weight: 346.81

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Clc1cc(NCc2ccc3c(c2)OCO3)ccc1N1CCOCC1

Standard InChI:  InChI=1S/C18H19ClN2O3/c19-15-10-14(2-3-16(15)21-5-7-22-8-6-21)20-11-13-1-4-17-18(9-13)24-12-23-17/h1-4,9-10,20H,5-8,11-12H2

Standard InChI Key:  WCFCHPLECYPJIG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
    2.6700   -6.9405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3797   -6.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3769   -5.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6683   -5.3032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0881   -6.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7951   -6.5289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5035   -6.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5001   -7.7520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2076   -8.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9157   -7.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9118   -6.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2037   -6.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6247   -8.1580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6218   -8.9788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3267   -9.3870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0372   -8.9807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0383   -8.1615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3288   -7.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9620   -6.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9632   -5.7151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1870   -5.4615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7060   -6.1214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1851   -6.7827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6200   -6.5193    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 19  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 20  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 19  1  0
 11 24  1  0
M  END

Associated Targets(Human)

ALDH2 Tclin Aldehyde dehydrogenase (509 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.81Molecular Weight (Monoisotopic): 346.1084AlogP: 3.52#Rotatable Bonds: 4
Polar Surface Area: 42.96Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.12CX LogP: 3.29CX LogD: 3.29
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.92Np Likeness Score: -1.50

References

1. Tian W,Guo J,Zhang Q,Fang S,Zhou R,Hu J,Wang M,Zhang Y,Guo JM,Chen Z,Zhu J,Zheng C.  (2021)  The discovery of novel small molecule allosteric activators of aldehyde dehydrogenase 2.,  212  [PMID:33383258] [10.1016/j.ejmech.2020.113119]

Source