3-((5,7-di-tert-butylbenzofuran-2-yl)(phenyl)methyl)-2-methyl-1H-indole

ID: ALA4751909

PubChem CID: 162653320

Max Phase: Preclinical

Molecular Formula: C32H35NO

Molecular Weight: 449.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1[nH]c2ccccc2c1C(c1ccccc1)c1cc2cc(C(C)(C)C)cc(C(C)(C)C)c2o1

Standard InChI:  InChI=1S/C32H35NO/c1-20-28(24-15-11-12-16-26(24)33-20)29(21-13-9-8-10-14-21)27-18-22-17-23(31(2,3)4)19-25(30(22)34-27)32(5,6)7/h8-19,29,33H,1-7H3

Standard InChI Key:  JNHOPGNLQRRAPY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   36.5700   -9.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5688  -10.5598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2769  -10.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2751   -9.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9837   -9.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9885  -10.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7685  -10.8037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.2459  -10.1386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7608   -9.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0630  -10.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4758  -10.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4675   -9.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7350   -8.1319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.1311   -8.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0689  -11.5479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4809  -12.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2990  -12.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7032  -11.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2888  -10.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4452   -8.5363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2786   -9.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8850   -9.8746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6583   -9.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8217   -8.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2139   -8.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3306   -8.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8621   -9.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8620   -8.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1545   -9.7406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1516   -8.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2779  -11.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5707  -12.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9861  -12.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2730  -12.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 21  1  0
 20 13  1  0
 13 14  1  0
 14 12  2  0
 11 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 11  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 14 26  1  0
  1 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
  3 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4751909

    ---

Associated Targets(Human)

SiHa (2051 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.64Molecular Weight (Monoisotopic): 449.2719AlogP: 9.00#Rotatable Bonds: 3
Polar Surface Area: 28.93Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 8.88CX LogD: 8.88
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -0.33

References

1. Siddiqui SK,SahayaSheela VJ,Kolluru S,Pandian GN,Santhoshkumar TR,Dan VM,Ramana CV.  (2020)  Discovery of 3-(benzofuran-2-ylmethyl)-1H-indole derivatives as potential autophagy inducers in cervical cancer cells.,  30  (19): [PMID:32769048] [10.1016/j.bmcl.2020.127431]

Source