[(2R,3R,11bR)-3-isobutyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-hydroxy-3-methyl-butanoate

ID: ALA4752068

PubChem CID: 133082445

Max Phase: Preclinical

Molecular Formula: C24H38N2O5

Molecular Weight: 434.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)[C@H]1C[C@@H](OC(=O)[C@@H](N)C(C)(C)O)[C@H](CC(C)C)CN1CC2

Standard InChI:  InChI=1S/C24H38N2O5/c1-14(2)9-16-13-26-8-7-15-10-20(29-5)21(30-6)11-17(15)18(26)12-19(16)31-23(27)22(25)24(3,4)28/h10-11,14,16,18-19,22,28H,7-9,12-13,25H2,1-6H3/t16-,18-,19-,22-/m1/s1

Standard InChI Key:  RPHPRWCGGJGIHI-WGQQHEPDSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   18.0645  -10.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7776   -9.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4911  -10.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4911  -11.0144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7801  -11.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0645  -11.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3512  -11.4303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3512  -12.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2042  -11.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9175  -11.0145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9175  -10.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2042   -9.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6348  -11.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6347  -12.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9174  -12.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2042  -12.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9174  -13.4908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2042  -13.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2042  -14.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9174  -15.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6347  -14.7268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5057  -15.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3310  -15.8567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4910  -15.1416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4910  -13.4908    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3480  -12.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0612  -12.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7745  -12.6653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0612  -11.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4911  -11.8399    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.3512   -9.7790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6380  -10.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  3 12  1  0
 10 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
  9 16  1  0
 15 17  1  6
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 19 24  1  6
 18 25  2  0
 14 26  1  1
 26 27  1  0
 27 28  1  0
 27 29  1  0
  9 30  1  1
  1 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4752068

    ---

Associated Targets(non-human)

Slc18a2 Synaptic vesicular amine transporter (631 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.58Molecular Weight (Monoisotopic): 434.2781AlogP: 2.68#Rotatable Bonds: 7
Polar Surface Area: 94.25Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.37CX LogP: 2.41CX LogD: 1.27
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.64Np Likeness Score: 1.22

References

1. Shanu-Wilson J,Evans L,Wrigley S,Steele J,Atherton J,Boer J.  (2020)  Biotransformation: Impact and Application of Metabolism in Drug Discovery.,  11  (11): [PMID:33214818] [10.1021/acsmedchemlett.0c00202]

Source