disodium mono(2-(4-butyl-1H-1,2,3-triazol-1-yl)-1-hydroxyethane-1,1-diyldiphosphonate)

ID: ALA4752134

PubChem CID: 162653436

Max Phase: Preclinical

Molecular Formula: C8H15N3Na2O7P2

Molecular Weight: 329.19

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCc1cn(CC(O)(P(=O)([O-])O)P(=O)([O-])O)nn1.[Na+].[Na+]

Standard InChI:  InChI=1S/C8H17N3O7P2.2Na/c1-2-3-4-7-5-11(10-9-7)6-8(12,19(13,14)15)20(16,17)18;;/h5,12H,2-4,6H2,1H3,(H2,13,14,15)(H2,16,17,18);;/q;2*+1/p-2

Standard InChI Key:  WUQVDNQLHPYSKS-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 22 20  0  0  0  0  0  0  0  0999 V2000
   15.7370   -7.9040    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
   20.1203   -8.1914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4078   -8.6081    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   20.1248   -9.0168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9828   -8.6039    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   17.1708   -8.3083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7036   -7.3707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6995   -8.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4202   -6.9618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8911   -7.4665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9787   -9.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4036   -9.4330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1079   -9.1539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1677   -7.2998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7229   -6.6895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.3140   -5.9730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5062   -6.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6532   -5.2210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1717   -4.5512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5110   -3.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0293   -3.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2328   -8.1206    0.0000 Na  0  0  0  0  0 15  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  6  5  1  0
  7  8  1  0
  7  9  1  0
  8  5  1  0
  8  3  1  0
  8 10  1  0
  5 11  2  0
  3 12  2  0
  5 13  1  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17  9  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
M  CHG  4   1   1   2  -1   6  -1  22   1
M  END

Associated Targets(Human)

GGPS1 Tchem Geranylgeranyl pyrophosphate synthetase (715 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 329.19Molecular Weight (Monoisotopic): 329.0542AlogP: -0.38#Rotatable Bonds: 7
Polar Surface Area: 166.00Molecular Species: ACIDHBA: 6HBD: 5
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 0.86CX Basic pKa: 0.30CX LogP: -1.83CX LogD: -6.05
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.42Np Likeness Score: -0.74

References

1. Legigan T,Migianu-Griffoni E,Redouane MA,Descamps A,Deschamp J,Gager O,Monteil M,Barbault F,Lecouvey M.  (2021)  Synthesis and preliminary anticancer evaluation of new triazole bisphosphonate-based isoprenoid biosynthesis inhibitors.,  214  [PMID:33571830] [10.1016/j.ejmech.2021.113241]

Source