4-methyl-N-(5-(3-nitrophenyl)-4-(piperidin-1-ylmethyl)thiazol-2-yl)benzenesulfonamide

ID: ALA4752276

PubChem CID: 162652862

Max Phase: Preclinical

Molecular Formula: C22H24N4O4S2

Molecular Weight: 472.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)Nc2nc(CN3CCCCC3)c(-c3cccc([N+](=O)[O-])c3)s2)cc1

Standard InChI:  InChI=1S/C22H24N4O4S2/c1-16-8-10-19(11-9-16)32(29,30)24-22-23-20(15-25-12-3-2-4-13-25)21(31-22)17-6-5-7-18(14-17)26(27)28/h5-11,14H,2-4,12-13,15H2,1H3,(H,23,24)

Standard InChI Key:  HBOLQRQDGVAUHB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   18.9440  -16.3603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7364  -16.5750    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.5261  -15.7814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7182  -18.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5354  -18.4033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.7897  -17.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1268  -17.1445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4680  -17.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2375  -19.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4239  -18.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9429  -19.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2743  -20.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0914  -20.4648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5688  -19.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5673  -17.3752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5158  -16.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1206  -16.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8976  -16.6227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0692  -15.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4578  -15.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6832  -15.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8464  -15.5704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6907  -17.3745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5204  -16.5752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1317  -16.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9641  -15.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1878  -14.9793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5787  -15.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7460  -16.3281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1248  -19.5472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6433  -20.2075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7938  -18.8001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  2  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  4  9  1  0
  6 15  1  0
 15  2  1  0
  2 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
  8 23  1  0
 23 24  1  0
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 30 31  2  0
 30 32  1  0
 11 30  1  0
M  CHG  2  30   1  32  -1
M  END

Alternative Forms

  1. Parent:

    ALA4752276

    ---

Associated Targets(non-human)

Kmo Kynurenine 3-monooxygenase (34 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.59Molecular Weight (Monoisotopic): 472.1239AlogP: 4.81#Rotatable Bonds: 7
Polar Surface Area: 105.44Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.01CX Basic pKa: 6.37CX LogP: 4.30CX LogD: 4.19
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: -1.98

References

1. Kimura H,Suda H,Kassai M,Endo M,Deai Y,Yahata M,Miyajima M,Isobe Y.  (2021)  N-(6-phenylpyridazin-3-yl)benzenesulfonamides as highly potent, brain-permeable, and orally active kynurenine monooxygenase inhibitors.,  33  [PMID:33359168] [10.1016/j.bmcl.2020.127753]

Source