The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-methoxy-5-[(1-methylindol-3-yl)methyl]-N-(4-nitrophenyl)sulfonyl-benzamide ID: ALA4752352
PubChem CID: 162652455
Max Phase: Preclinical
Molecular Formula: C24H21N3O6S
Molecular Weight: 479.51
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cc2cn(C)c3ccccc23)cc1C(=O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C24H21N3O6S/c1-26-15-17(20-5-3-4-6-22(20)26)13-16-7-12-23(33-2)21(14-16)24(28)25-34(31,32)19-10-8-18(9-11-19)27(29)30/h3-12,14-15H,13H2,1-2H3,(H,25,28)
Standard InChI Key: HLUARFLHDDIWJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
18.3662 -24.9120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1586 -25.1266 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
18.9482 -24.3330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5730 -29.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5719 -29.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2799 -30.2346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2781 -28.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9868 -29.0025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9870 -29.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7700 -30.0799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2537 -29.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7696 -28.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0219 -27.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8211 -27.8005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3651 -28.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1637 -28.2428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4167 -27.4648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8649 -26.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0684 -27.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2158 -27.2936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7636 -27.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1145 -26.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9131 -25.9052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5653 -25.4730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9613 -24.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5087 -25.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3108 -25.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5634 -24.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0078 -24.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2078 -24.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0227 -30.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3641 -24.4380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9131 -25.0433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6138 -23.6599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
18 22 1 0
22 23 1 0
22 24 2 0
23 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
10 31 1 0
32 33 1 0
32 34 2 0
28 32 1 0
M CHG 2 32 1 33 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.51Molecular Weight (Monoisotopic): 479.1151AlogP: 3.80#Rotatable Bonds: 7Polar Surface Area: 120.54Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.18CX Basic pKa: ┄CX LogP: 4.62CX LogD: 3.68Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.32Np Likeness Score: -1.06
References 1. Howard KC,Gonzalez OA,Garneau-Tsodikova S. (2020) Second Generation of Zafirlukast Derivatives with Improved Activity against the Oral Pathogen Porphyromonas gingivalis., 11 (10): [PMID:33062172 ] [10.1021/acsmedchemlett.9b00614 ]