The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R,4R,5S,6R)-2-(5-(chroman-6-ylmethyl)-2-hydroxy-4-methoxyphenyl)-5-fluoro-6-(hydroxymethyl)-5-methyltetrahydro-2H-pyran-3,4-diol ID: ALA4752364
PubChem CID: 162652542
Max Phase: Preclinical
Molecular Formula: C24H29FO7
Molecular Weight: 448.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c([C@@H]2O[C@H](CO)[C@@](C)(F)[C@H](O)[C@H]2O)cc1Cc1ccc2c(c1)CCCO2
Standard InChI: InChI=1S/C24H29FO7/c1-24(25)20(12-26)32-22(21(28)23(24)29)16-10-15(19(30-2)11-17(16)27)9-13-5-6-18-14(8-13)4-3-7-31-18/h5-6,8,10-11,20-23,26-29H,3-4,7,9,12H2,1-2H3/t20-,21+,22+,23-,24-/m1/s1
Standard InChI Key: SUDLIXRHTBWUAX-OYTPZHDJSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
27.0379 -4.6667 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.4587 -3.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6292 -3.9455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4587 -3.1209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1749 -4.3626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8911 -3.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8911 -3.1209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1749 -2.7042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6069 -2.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1749 -5.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7389 -2.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6051 -4.3678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7365 -1.8813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.3167 -3.1289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0319 -2.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0348 -1.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3165 -1.4788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6043 -1.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7450 -3.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4608 -2.7240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1698 -3.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1703 -1.4920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4578 -1.9037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8884 -1.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8837 -2.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5894 -3.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3043 -2.7368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3090 -1.9149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5987 -1.4975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7499 -1.4818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7512 -0.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8889 -1.4798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 2 1 0
4 8 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
7 9 1 1
5 10 1 1
4 11 1 1
6 12 1 6
11 13 1 0
9 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 9 1 0
15 19 1 0
19 20 1 0
20 21 2 0
21 25 1 0
24 22 1 0
22 23 2 0
23 20 1 0
24 25 2 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
16 30 1 0
30 31 1 0
18 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.49Molecular Weight (Monoisotopic): 448.1897AlogP: 2.20#Rotatable Bonds: 5Polar Surface Area: 108.61Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.24CX Basic pKa: ┄CX LogP: 2.34CX LogD: 2.34Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.56Np Likeness Score: 1.10
References 1. Xu G,Du F,Kuo GH,Xu JZ,Liang Y,Demarest K,Gaul MD. (2020) 5,5-Difluoro- and 5-Fluoro-5-methyl-hexose-based C-Glucosides as potent and orally bioavailable SGLT1 and SGLT2 dual inhibitors., 30 (17): [PMID:32738984 ] [10.1016/j.bmcl.2020.127387 ]