The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
diethyl 4-((2-(1-((2-(4-(trifluoromethoxy)phenyl)-1H-benzo[d]imidazol-6-yl)methyl)piperidin-4-yloxy)phenoxy)methyl)benzylphosphonate ID: ALA4752401
PubChem CID: 134346163
Max Phase: Preclinical
Molecular Formula: C38H41F3N3O6P
Molecular Weight: 723.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(Cc1ccc(COc2ccccc2OC2CCN(Cc3ccc4nc(-c5ccc(OC(F)(F)F)cc5)[nH]c4c3)CC2)cc1)OCC
Standard InChI: InChI=1S/C38H41F3N3O6P/c1-3-47-51(45,48-4-2)26-28-11-9-27(10-12-28)25-46-35-7-5-6-8-36(35)49-31-19-21-44(22-20-31)24-29-13-18-33-34(23-29)43-37(42-33)30-14-16-32(17-15-30)50-38(39,40)41/h5-18,23,31H,3-4,19-22,24-26H2,1-2H3,(H,42,43)
Standard InChI Key: WJZURZWQRYVBGO-UHFFFAOYSA-N
Molfile:
RDKit 2D
51 56 0 0 0 0 0 0 0 0999 V2000
17.5215 -10.3921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7044 -10.3766 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
17.0995 -11.0920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7817 -11.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4990 -11.4423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5118 -10.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8109 -10.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0815 -11.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0937 -10.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3210 -10.3355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8312 -10.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3013 -11.6565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0186 -10.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6212 -10.2622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8049 -10.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3850 -10.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7874 -11.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6024 -11.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1995 -11.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9142 -11.4669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6091 -11.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3216 -11.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3400 -10.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6397 -10.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9210 -10.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0562 -10.2873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7551 -10.7108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7328 -11.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4308 -11.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1480 -11.5558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1628 -10.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4641 -10.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4769 -9.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1909 -9.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8921 -9.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8774 -10.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5778 -10.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2928 -10.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3031 -9.5372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6021 -9.1213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9946 -10.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7158 -9.5595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9434 -9.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7605 -9.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9166 -11.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3117 -11.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5679 -10.9407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1689 -10.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3518 -10.2164 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5870 -9.5254 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7553 -9.5174 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 13 1 0
5 19 1 0
19 20 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
38 41 1 0
41 2 1 0
2 42 2 0
1 43 1 0
43 44 1 0
3 45 1 0
45 46 1 0
16 47 1 0
47 48 1 0
48 49 1 0
48 50 1 0
48 51 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 723.73Molecular Weight (Monoisotopic): 723.2685AlogP: 9.52#Rotatable Bonds: 15Polar Surface Area: 95.14Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.45CX Basic pKa: 8.31CX LogP: 8.39CX LogD: 7.42Aromatic Rings: 5Heavy Atoms: 51QED Weighted: 0.11Np Likeness Score: -0.85
References 1. Bessières M,Plebanek E,Chatterjee P,Shrivastava-Ranjan P,Flint M,Spiropoulou CF,Warszycki D,Bojarski AJ,Roy V,Agrofoglio LA. (2021) Design, synthesis and biological evaluation of 2-substituted-6-[(4-substituted-1-piperidyl)methyl]-1H-benzimidazoles as inhibitors of ebola virus infection., 214 [PMID:33548632 ] [10.1016/j.ejmech.2021.113211 ]