The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-((4-(1-cyclopropyl-1H-indol-3-yl)pyrimidin-2-yl)amino)-4-methoxy-2-(2-(methylsulfinyl)ethoxy)phenyl)acrylamide ID: ALA4752548
PubChem CID: 162653397
Max Phase: Preclinical
Molecular Formula: C28H29N5O4S
Molecular Weight: 531.64
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cc(Nc2nccc(-c3cn(C4CC4)c4ccccc34)n2)c(OC)cc1OCC[S+](C)[O-]
Standard InChI: InChI=1S/C28H29N5O4S/c1-4-27(34)30-23-15-22(25(36-2)16-26(23)37-13-14-38(3)35)32-28-29-12-11-21(31-28)20-17-33(18-9-10-18)24-8-6-5-7-19(20)24/h4-8,11-12,15-18H,1,9-10,13-14H2,2-3H3,(H,30,34)(H,29,31,32)
Standard InChI Key: QABLHOIDLNNPTB-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
5.2319 -12.3248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2307 -13.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9455 -13.5650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6619 -13.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6591 -12.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9437 -11.9120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3732 -11.9080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0829 -12.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7948 -11.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9411 -14.3919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2245 -14.8006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5125 -13.5623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7999 -13.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8066 -12.3212 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0950 -11.9055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3776 -12.3146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3763 -13.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0886 -13.5560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0990 -11.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7689 -10.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5181 -9.8114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0064 -9.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4341 -10.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6965 -9.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1515 -9.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3440 -9.3575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0845 -10.1431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6311 -10.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5088 -12.3260 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.9464 -11.0857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2334 -10.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2362 -9.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5175 -11.0810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9520 -9.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7633 -8.8133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0984 -8.3249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2239 -11.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5076 -13.1510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
3 10 1 0
10 11 1 0
2 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
19 20 2 0
20 21 1 0
21 24 1 0
23 19 1 0
15 19 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
9 29 1 0
6 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 2 0
35 22 1 0
36 35 1 0
22 36 1 0
29 37 1 0
29 38 1 0
M CHG 2 29 1 38 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.64Molecular Weight (Monoisotopic): 531.1940AlogP: 5.07#Rotatable Bonds: 11Polar Surface Area: 113.36Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.81CX Basic pKa: 1.37CX LogP: 3.24CX LogD: 3.24Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -0.78
References 1. Li J,An B,Song X,Zhang Q,Chen C,Wei S,Fan R,Li X,Zou Y. (2021) Design, synthesis and biological evaluation of novel 2,4-diaryl pyrimidine derivatives as selective EGFR inhibitors., 212 [PMID:33429247 ] [10.1016/j.ejmech.2020.113019 ]