The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(7S,16R,17S)-7,16,17-trihydroxydocosa-4,8,10,12,14-pentaenoic acid ID: ALA4752691
PubChem CID: 162653412
Max Phase: Preclinical
Molecular Formula: C22H34O5
Molecular Weight: 378.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC[C@H](O)[C@H](O)/C=C/C=C/C=C\C=C\[C@@H](O)C/C=C\CCC(=O)O
Standard InChI: InChI=1S/C22H34O5/c1-2-3-9-16-20(24)21(25)17-12-7-5-4-6-10-14-19(23)15-11-8-13-18-22(26)27/h4-8,10-12,14,17,19-21,23-25H,2-3,9,13,15-16,18H2,1H3,(H,26,27)/b6-4-,7-5+,11-8-,14-10+,17-12+/t19-,20+,21-/m1/s1
Standard InChI Key: NHEQLDHOIDACCJ-YPOUZGMCSA-N
Molfile:
RDKit 2D
27 26 0 0 0 0 0 0 0 0999 V2000
14.1027 -4.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8104 -4.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1027 -5.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8104 -5.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5182 -5.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5182 -4.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8104 -3.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1027 -2.8519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5182 -2.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5182 -2.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2259 -1.6261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9336 -2.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6413 -1.6261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3490 -2.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3490 -2.8519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0567 -1.6261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2259 -4.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9336 -4.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6413 -4.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3490 -4.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6413 -3.2605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3490 -5.3035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0567 -4.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7644 -4.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4721 -4.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4721 -3.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1798 -2.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
2 7 1 0
7 8 1 1
7 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
6 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
19 21 1 1
20 22 1 6
20 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.51Molecular Weight (Monoisotopic): 378.2406AlogP: 3.69#Rotatable Bonds: 15Polar Surface Area: 97.99Molecular Species: ACIDHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.64CX Basic pKa: ┄CX LogP: 3.58CX LogD: 0.89Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.20Np Likeness Score: 2.07
References 1. Schoeder CT,Mahardhika AB,Drabczyńska A,Kieć-Kononowicz K,Müller CE. (2020) Discovery of Tricyclic Xanthines as Agonists of the Cannabinoid-Activated Orphan G-Protein-Coupled Receptor GPR18., 11 (10): [PMID:33062188 ] [10.1021/acsmedchemlett.0c00208 ]