The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-Nalpha-Diphenylacetyl-Nomega-(glycinylaminoethyl)aminocarbonyl(4-hydroxybenzyl)argininamide bis(hydrotrifluoroacetate) ID: ALA4752935
PubChem CID: 162653307
Max Phase: Preclinical
Molecular Formula: C34H41F3N8O7
Molecular Weight: 616.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCC(=O)NCCNC(=O)/N=C(/N)NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C32H40N8O5.C2HF3O2/c33-20-27(42)35-18-19-37-32(45)40-31(34)36-17-7-12-26(29(43)38-21-22-13-15-25(41)16-14-22)39-30(44)28(23-8-3-1-4-9-23)24-10-5-2-6-11-24;3-2(4,5)1(6)7/h1-6,8-11,13-16,26,28,41H,7,12,17-21,33H2,(H,35,42)(H,38,43)(H,39,44)(H4,34,36,37,40,45);(H,6,7)/t26-;/m1./s1
Standard InChI Key: XOAGCYKWPOLCJD-UFTMZEDQSA-N
Molfile:
RDKit 2D
52 53 0 0 0 0 0 0 0 0999 V2000
26.6619 -3.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3696 -2.6786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0773 -3.0872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3696 -1.8614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9542 -2.6786 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
26.6619 -3.9044 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.9520 -3.4916 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.4392 -3.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1470 -3.3100 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.7315 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0238 -3.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7315 -2.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8547 -3.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5624 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2701 -3.7186 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9778 -3.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6855 -3.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4426 -2.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4430 -1.2716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7347 -0.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0247 -1.2751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0278 -2.0902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3167 -3.3069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6095 -3.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6090 -4.5329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3217 -4.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0260 -4.5311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6834 -4.5369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3903 -4.9454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0990 -4.5368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0963 -3.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3889 -3.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4392 -4.5358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5624 -2.4928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8072 -4.9444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8547 -4.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5624 -4.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5624 -5.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2701 -6.1702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.2701 -6.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5624 -7.3960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9778 -7.3960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6855 -6.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3932 -7.3960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.1009 -6.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8086 -7.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5163 -6.9874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.2240 -7.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9317 -6.9874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2240 -8.2132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6855 -6.1702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6395 -7.3960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
8 9 1 0
8 10 1 0
10 11 1 0
10 12 1 0
9 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
11 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 11 1 0
17 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 17 1 0
8 33 2 0
14 34 2 0
30 35 1 0
13 36 1 1
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
40 42 2 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
47 48 1 0
48 49 1 0
48 50 2 0
43 51 2 0
49 52 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.72Molecular Weight (Monoisotopic): 616.3122AlogP: 0.79#Rotatable Bonds: 15Polar Surface Area: 213.06Molecular Species: BASEHBA: 6HBD: 8#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 10#RO5 Violations (Lipinski): 3CX Acidic pKa: 9.49CX Basic pKa: 9.07CX LogP: -0.18CX LogD: -2.06Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.07Np Likeness Score: -0.35
References 1. Buschmann, Jonas, Seiler, Theresa, Bernhardt, Gunther, Keller, Max, Wifling, David. (2020) Argininamide-type neuropeptide Y Y1 receptor antagonists: the nature of Nomega-carbamoyl substituents determines Y1R binding mode and affinity, 11 (2): [PMID:33479634 ] [10.1039/c9md00538b ]