The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-{[3-(3,4,5-Trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy}-4-methyl-2H-chromen-2-one ID: ALA4753040
PubChem CID: 162653777
Max Phase: Preclinical
Molecular Formula: C23H23NO7
Molecular Weight: 425.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C2=NOC(COc3ccc4c(C)cc(=O)oc4c3)C2)cc(OC)c1OC
Standard InChI: InChI=1S/C23H23NO7/c1-13-7-22(25)30-19-11-15(5-6-17(13)19)29-12-16-10-18(24-31-16)14-8-20(26-2)23(28-4)21(9-14)27-3/h5-9,11,16H,10,12H2,1-4H3
Standard InChI Key: HIIGLOFNNFJYGV-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
9.8007 -15.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7996 -15.8261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5076 -16.2351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5059 -14.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2145 -15.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2152 -15.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9238 -16.2290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6320 -15.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6273 -14.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9182 -14.5927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9139 -13.7756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3413 -16.2241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0916 -16.2341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3842 -15.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6762 -16.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9333 -15.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3860 -16.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7941 -17.2173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5935 -17.0479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5765 -16.4227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2455 -15.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4336 -15.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9519 -16.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2878 -16.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0987 -17.0816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1391 -16.1643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8063 -15.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8093 -17.6613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9963 -17.5781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1022 -14.8411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5834 -14.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 5 1 0
10 11 1 0
8 12 2 0
2 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
23 26 1 0
26 27 1 0
24 28 1 0
28 29 1 0
22 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.44Molecular Weight (Monoisotopic): 425.1475AlogP: 3.70#Rotatable Bonds: 7Polar Surface Area: 88.72Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.31CX LogP: 3.20CX LogD: 3.20Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -0.21
References 1. Lingaraju GS,Balaji KS,Jayarama S,Anil SM,Kiran KR,Sadashiva MP. (2018) Synthesis of new coumarin tethered isoxazolines as potential anticancer agents., 28 (23-24): [PMID:30396758 ] [10.1016/j.bmcl.2018.10.046 ]