7-{[3-(3,4,5-Trimethoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methoxy}-4-methyl-2H-chromen-2-one

ID: ALA4753040

PubChem CID: 162653777

Max Phase: Preclinical

Molecular Formula: C23H23NO7

Molecular Weight: 425.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(C2=NOC(COc3ccc4c(C)cc(=O)oc4c3)C2)cc(OC)c1OC

Standard InChI:  InChI=1S/C23H23NO7/c1-13-7-22(25)30-19-11-15(5-6-17(13)19)29-12-16-10-18(24-31-16)14-8-20(26-2)23(28-4)21(9-14)27-3/h5-9,11,16H,10,12H2,1-4H3

Standard InChI Key:  HIIGLOFNNFJYGV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    9.8007  -15.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7996  -15.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5076  -16.2351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5059  -14.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2145  -15.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2152  -15.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9238  -16.2290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6320  -15.8182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6273  -14.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9182  -14.5927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9139  -13.7756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3413  -16.2241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0916  -16.2341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3842  -15.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6762  -16.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9333  -15.9023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3860  -16.5092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7941  -17.2173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5935  -17.0479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5765  -16.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2455  -15.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4336  -15.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9519  -16.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2878  -16.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0987  -17.0816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1391  -16.1643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8063  -15.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8093  -17.6613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9963  -17.5781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1022  -14.8411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5834  -14.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
  8 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 23 26  1  0
 26 27  1  0
 24 28  1  0
 28 29  1  0
 22 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4753040

    ---

Associated Targets(Human)

UACC-903 (393 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.44Molecular Weight (Monoisotopic): 425.1475AlogP: 3.70#Rotatable Bonds: 7
Polar Surface Area: 88.72Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.31CX LogP: 3.20CX LogD: 3.20
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.53Np Likeness Score: -0.21

References

1. Lingaraju GS,Balaji KS,Jayarama S,Anil SM,Kiran KR,Sadashiva MP.  (2018)  Synthesis of new coumarin tethered isoxazolines as potential anticancer agents.,  28  (23-24): [PMID:30396758] [10.1016/j.bmcl.2018.10.046]

Source