3,5-dichloro-N-[3-chloro-4-[2-(trifluoromethyl)phenoxy]phenyl]-2-hydroxy-benzamide

ID: ALA4753158

PubChem CID: 162653649

Max Phase: Preclinical

Molecular Formula: C20H11Cl3F3NO3

Molecular Weight: 476.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Oc2ccccc2C(F)(F)F)c(Cl)c1)c1cc(Cl)cc(Cl)c1O

Standard InChI:  InChI=1S/C20H11Cl3F3NO3/c21-10-7-12(18(28)15(23)8-10)19(29)27-11-5-6-17(14(22)9-11)30-16-4-2-1-3-13(16)20(24,25)26/h1-9,28H,(H,27,29)

Standard InChI Key:  UQXTXHITDFJXSL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   27.8555  -12.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8562  -13.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5689  -13.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2772  -13.1108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2724  -12.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5633  -11.8811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9906  -13.5207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7008  -13.1053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4114  -13.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1212  -13.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1184  -12.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4000  -11.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6932  -12.2900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4118  -14.3410    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.8281  -11.8704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5421  -12.2753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2518  -11.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5464  -13.0966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9600  -12.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6693  -11.8585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6654  -11.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9465  -10.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2443  -11.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5288  -10.6393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9394   -9.8062    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   36.3830  -12.2637    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.5716  -14.3429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8653  -14.7538    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.2807  -14.7491    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   28.5645  -15.1593    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  9 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 17  1  0
 23 24  1  0
 22 25  1  0
 20 26  1  0
  3 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4753158

    ---

Associated Targets(Human)

STK39 Tchem STE20/SPS1-related proline-alanine-rich protein kinase (342 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.67Molecular Weight (Monoisotopic): 474.9757AlogP: 7.42#Rotatable Bonds: 4
Polar Surface Area: 58.56Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.95CX Basic pKa: CX LogP: 6.95CX LogD: 5.59
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.41Np Likeness Score: -1.34

References

1. Fujii S,Kikuchi E,Watanabe Y,Suzuyama H,Ishigami-Yuasa M,Mori T,Isobe K,Uchida S,Kagechika H.  (2020)  Structural development of N-(4-phenoxyphenyl)benzamide derivatives as novel SPAK inhibitors blocking WNK kinase signaling.,  30  (17): [PMID:32738993] [10.1016/j.bmcl.2020.127408]

Source