6-Bromo-N,3-dimethyl-2-phenyl-N-[2-(pyridin-2-yl)ethyl]quinoline-4-carboxamide

ID: ALA4753259

PubChem CID: 162653447

Max Phase: Preclinical

Molecular Formula: C25H22BrN3O

Molecular Weight: 460.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(-c2ccccc2)nc2ccc(Br)cc2c1C(=O)N(C)CCc1ccccn1

Standard InChI:  InChI=1S/C25H22BrN3O/c1-17-23(25(30)29(2)15-13-20-10-6-7-14-27-20)21-16-19(26)11-12-22(21)28-24(17)18-8-4-3-5-9-18/h3-12,14,16H,13,15H2,1-2H3

Standard InChI Key:  GVGBJLZVBCJYJY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   12.7307  -12.1588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4357  -11.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4357  -10.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7307  -10.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0216  -10.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3166  -10.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6076  -10.9330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6076  -11.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3166  -12.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0216  -11.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7307   -9.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0216   -9.2986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4357   -9.2986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1447   -9.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8538   -9.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8538   -8.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5629   -8.0729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5629   -7.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8538   -6.8471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1447   -7.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1447   -8.0729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1447  -12.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1447  -12.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8538  -13.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5629  -12.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5629  -12.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8538  -11.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1447  -10.5244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4357   -8.4815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8985  -10.5244    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  1 10  1  0
  5 10  1  0
 11 12  2  0
 11 13  1  0
  4 11  1  0
 14 15  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 15 16  1  0
 13 14  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 22 27  2  0
  2 22  1  0
  3 28  1  0
 13 29  1  0
  7 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4753259

    ---

Associated Targets(Human)

PTGFR Tclin Prostanoid FP receptor (687 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.38Molecular Weight (Monoisotopic): 459.0946AlogP: 5.68#Rotatable Bonds: 5
Polar Surface Area: 46.09Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.55CX LogP: 5.57CX LogD: 5.57
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -1.39

References

1. Beck H,Thaler T,Meibom D,Meininghaus M,Jörißen H,Dietz L,Terjung C,Bairlein M,von Bühler CJ,Anlauf S,Fürstner C,Stellfeld T,Schneider D,Gericke KM,Buyck T,Lovis K,Münster U,Anlahr J,Kersten E,Levilain G,Marossek V,Kast R.  (2020)  Potent and Selective Human Prostaglandin F (FP) Receptor Antagonist (BAY-6672) for the Treatment of Idiopathic Pulmonary Fibrosis (IPF).,  63  (20.0): [PMID:32969660] [10.1021/acs.jmedchem.0c00834]

Source