(S)-N-(2-(2-cyano-4,4-difluoropyrrolidin-1-yl)-2-oxoethyl)-2-((4'-cyanobiphenyl-4-yl)methyl)thiazole-4-carboxamide

ID: ALA4753316

PubChem CID: 155754787

Max Phase: Preclinical

Molecular Formula: C25H19F2N5O2S

Molecular Weight: 491.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(-c2ccc(Cc3nc(C(=O)NCC(=O)N4CC(F)(F)C[C@H]4C#N)cs3)cc2)cc1

Standard InChI:  InChI=1S/C25H19F2N5O2S/c26-25(27)10-20(12-29)32(15-25)23(33)13-30-24(34)21-14-35-22(31-21)9-16-1-5-18(6-2-16)19-7-3-17(11-28)4-8-19/h1-8,14,20H,9-10,13,15H2,(H,30,34)/t20-/m0/s1

Standard InChI Key:  YEVNJKBZDRFUJQ-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   38.8914   -9.8985    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   39.2821  -10.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7165   -9.9236    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.5306  -12.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9658  -11.9167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7860  -11.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9834  -11.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6519  -11.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3168  -12.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8476  -13.1219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.7059  -12.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9199  -13.3450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2707  -13.2920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.4460  -13.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0108  -13.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0567  -12.5382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1886  -14.0298    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9912  -14.8308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6922  -15.2661    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   36.3226  -14.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2272  -15.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1146  -15.9594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3486  -16.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2358  -17.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8878  -17.5918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6548  -17.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7640  -16.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7799  -18.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0147  -18.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9030  -19.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5557  -20.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3223  -19.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4303  -18.9091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4494  -20.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3390  -21.6752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  2  8  1  0
  8  5  1  0
  6  9  1  1
  9 10  3  0
  4 11  1  0
  4 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 15  2  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 25 28  1  0
 34 35  3  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4753316

    ---

Associated Targets(Human)

FAP Tchem Fibroblast activation protein alpha (827 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DPP4 Tclin Dipeptidyl peptidase IV (7109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PREP Tchem Prolyl endopeptidase (1176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.52Molecular Weight (Monoisotopic): 491.1228AlogP: 3.76#Rotatable Bonds: 6
Polar Surface Area: 109.88Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.22CX LogD: 3.22
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.56Np Likeness Score: -1.26

References

1. Jung HJ,Nam EH,Park JY,Ghosh P,Kim IS.  (2021)  Identification of BR102910 as a selective fibroblast activation protein (FAP) inhibitor.,  37  [PMID:33571650] [10.1016/j.bmcl.2021.127846]

Source