The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((3R,4S)-4-(6-(3,5-dimethoxyphenyl)-8-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-2-ylamino)tetrahydrofuran-3-yl)acrylamide ID: ALA4753393
PubChem CID: 90436774
Max Phase: Preclinical
Molecular Formula: C23H25N5O5
Molecular Weight: 451.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N[C@H]1COC[C@H]1Nc1ncc2cc(-c3cc(OC)cc(OC)c3)c(=O)n(C)c2n1
Standard InChI: InChI=1S/C23H25N5O5/c1-5-20(29)25-18-11-33-12-19(18)26-23-24-10-14-8-17(22(30)28(2)21(14)27-23)13-6-15(31-3)9-16(7-13)32-4/h5-10,18-19H,1,11-12H2,2-4H3,(H,25,29)(H,24,26,27)/t18-,19+/m0/s1
Standard InChI Key: KZGOHFREJPYORJ-RBUKOAKNSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
9.2642 -18.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2631 -19.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9752 -20.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6890 -19.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6862 -18.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9734 -18.4113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5544 -20.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8472 -19.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8437 -21.2799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5599 -20.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1323 -20.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1409 -20.0497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4366 -19.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7232 -20.0373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7186 -20.8593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4235 -21.2686 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9710 -17.5899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6816 -17.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4015 -20.0549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4028 -20.8762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2669 -21.2836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8402 -22.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0045 -21.2641 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2949 -20.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2127 -20.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4101 -19.8546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9977 -20.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5413 -21.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3663 -21.9808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5833 -22.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4083 -23.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6253 -23.2823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9754 -21.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
7 10 1 0
8 12 1 0
11 9 1 0
9 10 1 0
2 7 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
6 17 1 0
17 18 1 0
4 19 1 0
19 20 1 0
10 21 2 0
9 22 1 0
15 23 1 0
24 23 1 1
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
28 29 1 1
29 30 1 0
30 31 1 0
31 32 2 0
30 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.48Molecular Weight (Monoisotopic): 451.1856AlogP: 1.49#Rotatable Bonds: 7Polar Surface Area: 116.60Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.52CX Basic pKa: 3.64CX LogP: 1.32CX LogD: 1.32Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -0.29
References 1. Liu H,Niu D,Tham Sjin RT,Dubrovskiy A,Zhu Z,McDonald JJ,Fahnoe K,Wang Z,Munson M,Scholte A,Barrague M,Fitzgerald M,Liu J,Kothe M,Sun F,Murtie J,Ge J,Rocnik J,Harvey D,Ospina B,Perron K,Zheng G,Shehu E,D'Agostino LA. (2020) Discovery of Selective, Covalent FGFR4 Inhibitors with Antitumor Activity in Models of Hepatocellular Carcinoma., 11 (10): [PMID:33062171 ] [10.1021/acsmedchemlett.9b00601 ]