6-(Piperidin-1-yl(pyridin-4-yl)methyl)benzofuran-7-ol

ID: ALA4753606

PubChem CID: 162653899

Max Phase: Preclinical

Molecular Formula: C19H20N2O2

Molecular Weight: 308.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1c(C(c2ccncc2)N2CCCCC2)ccc2ccoc12

Standard InChI:  InChI=1S/C19H20N2O2/c22-18-16(5-4-15-8-13-23-19(15)18)17(14-6-9-20-10-7-14)21-11-2-1-3-12-21/h4-10,13,17,22H,1-3,11-12H2

Standard InChI Key:  GJSGJEFEHZQMOS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   14.8317   -9.2761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3003   -9.9464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8088  -10.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0377  -10.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0528   -9.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3232  -10.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6239  -10.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6349   -9.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3493   -9.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3603   -8.2826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9356   -9.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2582   -7.0235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2472   -7.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9465   -8.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6610   -7.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6720   -7.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9727   -6.6234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2211   -9.4746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5176   -9.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8032   -9.4495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7922  -10.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4915  -10.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2060  -10.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  5  9  2  0
  4  6  2  0
  9 10  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 11 14  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 18 23  1  0
 11 18  1  0
  8 11  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4753606

    ---

Associated Targets(Human)

P4HB Tchem Protein disulfide-isomerase (716 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
U-87 MG (3946 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 308.38Molecular Weight (Monoisotopic): 308.1525AlogP: 4.11#Rotatable Bonds: 3
Polar Surface Area: 49.50Molecular Species: ZWITTERIONHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.05CX Basic pKa: 9.32CX LogP: 1.91CX LogD: 1.91
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.79Np Likeness Score: -0.16

References

1. Shergalis A,Xue D,Gharbia FZ,Driks H,Shrestha B,Tanweer A,Cromer K,Ljungman M,Neamati N.  (2020)  Characterization of Aminobenzylphenols as Protein Disulfide Isomerase Inhibitors in Glioblastoma Cell Lines.,  63  (18): [PMID:32830969] [10.1021/acs.jmedchem.0c00728]

Source