The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4'-(1-decyl-2,3-triazol-4-yl)phenyl-2,2':6',2"-terpyridine ID: ALA4753674
PubChem CID: 162653636
Max Phase: Preclinical
Molecular Formula: C33H36N6
Molecular Weight: 516.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCn1cc(-c2ccc(-c3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc2)nn1
Standard InChI: InChI=1S/C33H36N6/c1-2-3-4-5-6-7-8-13-22-39-25-33(37-38-39)27-18-16-26(17-19-27)28-23-31(29-14-9-11-20-34-29)36-32(24-28)30-15-10-12-21-35-30/h9-12,14-21,23-25H,2-8,13,22H2,1H3
Standard InChI Key: IPNHHWMEUBLGLU-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
1.9219 -10.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9207 -11.3398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6288 -11.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3384 -11.3393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3356 -10.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6270 -10.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0418 -10.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7483 -10.5143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4540 -10.1038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4513 -9.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7371 -8.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0343 -9.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1630 -10.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1619 -11.3262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8701 -11.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5774 -11.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5721 -10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8633 -10.0975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7311 -8.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4368 -7.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4312 -6.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7200 -6.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0130 -6.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0221 -7.6657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7130 -5.6154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3677 -5.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1085 -4.3585 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2913 -4.3655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0456 -5.1449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5831 -3.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3965 -3.7716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8711 -3.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6845 -3.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1592 -2.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9726 -2.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4472 -1.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2606 -2.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7352 -1.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5486 -1.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
9 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 25 1 0
27 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.69Molecular Weight (Monoisotopic): 516.3001AlogP: 8.27#Rotatable Bonds: 13Polar Surface Area: 69.38Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.24CX LogP: 8.88CX LogD: 8.88Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.15Np Likeness Score: -0.91
References 1. Malarz K,Zych D,Kuczak M,Musioł R,Mrozek-Wilczkiewicz A. (2020) Anticancer activity of 4'-phenyl-2,2':6',2″-terpyridines - behind the metal complexation., 189 [PMID:31962262 ] [10.1016/j.ejmech.2020.112039 ]