8-bromo-6-chloro-N-(4-guanidinophenyl)-2-oxo-2H-chromene-3-carboxamide

ID: ALA4753701

PubChem CID: 162653815

Max Phase: Preclinical

Molecular Formula: C17H12BrClN4O3

Molecular Weight: 435.67

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(N)Nc1ccc(NC(=O)c2cc3cc(Cl)cc(Br)c3oc2=O)cc1

Standard InChI:  InChI=1S/C17H12BrClN4O3/c18-13-7-9(19)5-8-6-12(16(25)26-14(8)13)15(24)22-10-1-3-11(4-2-10)23-17(20)21/h1-7H,(H,22,24)(H4,20,21,23)

Standard InChI Key:  JGKOMXQXMFSESD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    5.3442  -12.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3431  -12.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0579  -13.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0561  -11.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7714  -12.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7703  -12.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4832  -13.3291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2019  -12.9181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2030  -12.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4856  -11.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9152  -13.3327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9186  -11.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6320  -12.0922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9206  -10.8531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3475  -11.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0573  -12.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7722  -11.6889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7747  -10.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0562  -10.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3441  -10.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4895  -10.4514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4904   -9.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2054   -9.2147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7765   -9.2131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6297  -11.6790    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.0596  -14.1565    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  8 11  2  0
 12 13  1  0
 12 14  2  0
  9 12  1  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
  1 25  1  0
  3 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4753701

    ---

Associated Targets(Human)

F12 Tchem Coagulation factor XII (1450 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.67Molecular Weight (Monoisotopic): 433.9781AlogP: 3.77#Rotatable Bonds: 3
Polar Surface Area: 121.21Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.06CX LogP: 3.15CX LogD: 2.41
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.28Np Likeness Score: -0.93

References

1. Davoine C,Bouckaert C,Fillet M,Pochet L.  (2020)  Factor XII/XIIa inhibitors: Their discovery, development, and potential indications.,  208  [PMID:32883641] [10.1016/j.ejmech.2020.112753]

Source