The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[4-[(2,4-dioxothiazolidin-5-ylidene)methyl]phenoxy]-N-(3-nitrophenyl)acetamide ID: ALA4753740
PubChem CID: 18808533
Max Phase: Preclinical
Molecular Formula: C18H13N3O6S
Molecular Weight: 399.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1ccc(/C=C2\SC(=O)NC2=O)cc1)Nc1cccc([N+](=O)[O-])c1
Standard InChI: InChI=1S/C18H13N3O6S/c22-16(19-12-2-1-3-13(9-12)21(25)26)10-27-14-6-4-11(5-7-14)8-15-17(23)20-18(24)28-15/h1-9H,10H2,(H,19,22)(H,20,23,24)/b15-8-
Standard InChI Key: ZFMUGCAJQUPHAQ-NVNXTCNLSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
19.3883 -2.7528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3872 -3.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0993 -3.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8090 -3.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8062 -2.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0975 -2.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5165 -2.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2298 -2.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3174 -3.5598 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.1215 -3.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5316 -3.0174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.9783 -2.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4609 -4.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1447 -1.6040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6750 -3.9887 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9635 -3.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2513 -3.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5398 -3.5742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2507 -4.8088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8310 -3.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1264 -3.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4181 -3.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4155 -4.7938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1271 -5.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8325 -4.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7090 -3.5625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0000 -3.9689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7115 -2.7453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
10 13 2 0
12 14 2 0
2 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
26 27 2 0
26 28 1 0
22 26 1 0
M CHG 2 26 1 28 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.38Molecular Weight (Monoisotopic): 399.0525AlogP: 2.94#Rotatable Bonds: 6Polar Surface Area: 127.64Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.20CX Basic pKa: ┄CX LogP: 2.54CX LogD: 1.39Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.43Np Likeness Score: -1.96
References 1. Joshi H,Patil V,Tilekar K,Upadhyay N,Gota V,Ramaa CS. (2020) Benzylidene thiazolidinediones: Synthesis, in vitro investigations of antiproliferative mechanisms and in vivo efficacy determination in combination with Imatinib., 30 (23.0): [PMID:32961322 ] [10.1016/j.bmcl.2020.127561 ]