Lycosquarrine I

ID: ALA4753935

PubChem CID: 162654463

Max Phase: Preclinical

Molecular Formula: C15H20N2O2

Molecular Weight: 260.34

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1C[C@H]2Cc3[nH]c(=O)ccc3[C@@](N)(C1)/C2=C/CO

Standard InChI:  InChI=1S/C15H20N2O2/c1-9-6-10-7-13-12(2-3-14(19)17-13)15(16,8-9)11(10)4-5-18/h2-4,9-10,18H,5-8,16H2,1H3,(H,17,19)/b11-4+/t9-,10+,15-/m1/s1

Standard InChI Key:  PYKYIMCTZCJSJP-QDXUNGBRSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
   32.9749  -12.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8646  -12.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8544  -11.6105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5112  -13.0908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4996  -12.2847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5322  -11.1895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5627  -12.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2875  -11.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4327  -12.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2365  -11.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7472  -11.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0531  -11.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2473  -12.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4934  -13.2042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2241  -13.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9475  -11.1664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.3328  -10.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4103  -14.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6852  -12.4191    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.8888  -13.3732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  1  1  0
  5  4  1  0
  6  3  1  0
  7  2  1  0
  8 12  1  0
  9  5  1  0
 10 13  1  0
 11  1  1  0
 12 11  1  0
 13  7  2  0
  1 14  1  1
 15  4  2  0
 16 10  2  0
 12 17  1  1
 18 15  1  0
  5 19  1  6
  8  5  1  0
  9  3  1  0
 10  6  1  0
 18 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4753935

    ---

Associated Targets(non-human)

ACHE Acetylcholinesterase (1035 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 260.34Molecular Weight (Monoisotopic): 260.1525AlogP: 1.05#Rotatable Bonds: 1
Polar Surface Area: 79.11Molecular Species: BASEHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.70CX Basic pKa: 8.85CX LogP: -0.26CX LogD: -1.71
Aromatic Rings: 1Heavy Atoms: 19QED Weighted: 0.66Np Likeness Score: 1.90

References

1. Zhu X,Xia D,Zhou Z,Xie S,Shi Z,Chen G,Wang L,Pan K.  (2020)  Lycosquarrines A-R, Lycopodium Alkaloids from Phlegmariurus squarrosus.,  83  (10): [PMID:32941036] [10.1021/acs.jnatprod.9b00815]

Source