The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(2S,3S,5R)-5-{4-amino-3-[(2-fluoro-4-methylphenyl)sulfanyl]-1H-pyrazolo[3,4-d]pyrimidin-1-yl}-3-hydroxytetrahydrofuran-2-yl]methyl sulfamate ID: ALA4754045
PubChem CID: 134500786
Max Phase: Preclinical
Molecular Formula: C17H19FN6O5S2
Molecular Weight: 470.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(Sc2nn([C@H]3C[C@H](O)[C@H](COS(N)(=O)=O)O3)c3ncnc(N)c23)c(F)c1
Standard InChI: InChI=1S/C17H19FN6O5S2/c1-8-2-3-12(9(18)4-8)30-17-14-15(19)21-7-22-16(14)24(23-17)13-5-10(25)11(29-13)6-28-31(20,26)27/h2-4,7,10-11,13,25H,5-6H2,1H3,(H2,19,21,22)(H2,20,26,27)/t10-,11-,13+/m0/s1
Standard InChI Key: GRYCCRMITKNCNZ-GMXVVIOVSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
3.9910 -8.6094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5866 -7.9036 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1776 -8.6068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1799 -5.5868 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8896 -5.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8867 -4.3547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1781 -3.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1757 -3.1323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4718 -5.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4731 -4.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6926 -4.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2089 -4.7654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6906 -5.4303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4366 -6.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6591 -6.4632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6579 -7.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4347 -7.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9159 -6.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9960 -7.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6862 -8.3116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2500 -7.4263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8421 -7.5721 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4412 -3.3243 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.6422 -3.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3946 -2.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5963 -2.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1005 -3.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3028 -3.5938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0463 -2.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3560 -4.5376 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.2466 -2.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
9 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 10 1 0
7 8 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
14 13 1 1
16 19 1 6
17 20 1 6
19 21 1 0
21 2 1 0
2 22 1 0
11 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 29 2 0
28 27 2 0
27 24 1 0
28 29 1 0
27 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.51Molecular Weight (Monoisotopic): 470.0842AlogP: 0.88#Rotatable Bonds: 6Polar Surface Area: 168.47Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.33CX Basic pKa: 3.44CX LogP: 1.67CX LogD: 1.67Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -0.58
References 1. Huang SC,Adhikari S,Brownell JE,Calderwood EF,Chouitar J,D'Amore NR,England DB,Foley K,Harrison SJ,LeRoy PJ,Lok D,Lublinsky A,Ma LT,Menon S,Yang Y,Zhang J,Gould AE. (2020) Discovery and optimization of pyrazolopyrimidine sulfamates as ATG7 inhibitors., 28 (19): [PMID:32912429 ] [10.1016/j.bmc.2020.115681 ]