[(1R,5S,6R)-3-{5-Cyano-6-[(2S,3R)-3-hydroxy-2-methylazetidin-1-yl]-4-(trifluoromethyl)pyridin-2-yl}-3-azabicyclo[3.1.0]hex-6-yl]-acetic Acid

ID: ALA4754053

PubChem CID: 129278497

Max Phase: Preclinical

Molecular Formula: C18H19F3N4O3

Molecular Weight: 396.37

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H]1[C@H](O)CN1c1nc(N2C[C@@H]3[C@@H](CC(=O)O)[C@@H]3C2)cc(C(F)(F)F)c1C#N

Standard InChI:  InChI=1S/C18H19F3N4O3/c1-8-14(26)7-25(8)17-10(4-22)13(18(19,20)21)3-15(23-17)24-5-11-9(2-16(27)28)12(11)6-24/h3,8-9,11-12,14,26H,2,5-7H2,1H3,(H,27,28)/t8-,9-,11-,12+,14+/m0/s1

Standard InChI Key:  BMYWDILFDVCFJX-GMEDAVPMSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   13.7010   -7.4372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6998   -8.2609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4120   -8.6740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1258   -8.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1230   -7.4336    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4102   -7.0284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4078   -6.2071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9880   -5.6293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4043   -5.0491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8240   -5.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8093   -5.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4019   -4.2278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8383   -8.6720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9255   -9.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5889   -8.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9877   -8.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2762   -8.2598    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.9870   -9.4944    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.2703   -9.0758    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.9896   -7.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2777   -6.6167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1368   -8.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7314   -9.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5510   -9.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2643  -10.0576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7235  -10.4749    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.1321   -8.1183    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   18.9706   -9.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6838  -10.0527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9678   -8.8253    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  7  1  0
  8 11  1  6
  9 12  1  1
  4 13  1  0
 13 14  1  0
 14 23  1  0
 22 15  1  0
 15 13  1  0
  2 16  1  0
 16 17  1  0
 16 18  1  0
 16 19  1  0
 20 21  3  0
  1 20  1  0
 23 22  1  0
 24 23  1  0
 22 24  1  0
 24 25  1  1
 23 26  1  1
 22 27  1  1
 25 28  1  0
 28 29  1  0
 28 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4754053

    ---

Associated Targets(Human)

KHK Tchem Ketohexokinase (328 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
UGT1A4 Tbio UDP-glucuronosyltransferases (UGTs) (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.37Molecular Weight (Monoisotopic): 396.1409AlogP: 1.70#Rotatable Bonds: 4
Polar Surface Area: 100.69Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 2.54CX Basic pKa: 4.73CX LogP: 0.93CX LogD: -1.19
Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.80Np Likeness Score: -0.40

References

1. Futatsugi K,Smith AC,Tu M,Raymer B,Ahn K,Coffey SB,Dowling MS,Fernando DP,Gutierrez JA,Huard K,Jasti J,Kalgutkar AS,Knafels JD,Pandit J,Parris KD,Perez S,Pfefferkorn JA,Price DA,Ryder T,Shavnya A,Stock IA,Tsai AS,Tesz GJ,Thuma BA,Weng Y,Wisniewska HM,Xing G,Zhou J,Magee TV.  (2020)  Discovery of PF-06835919: A Potent Inhibitor of Ketohexokinase (KHK) for the Treatment of Metabolic Disorders Driven by the Overconsumption of Fructose.,  63  (22): [PMID:32910646] [10.1021/acs.jmedchem.0c00944]

Source